CAS 24039-08-5: 1,3-dimethylimidazolidine-2,4-dione
Description:1,3-Dimethylimidazolidine-2,4-dione, also known as dimethylhydantoin, is a cyclic urea derivative characterized by its five-membered ring structure containing two nitrogen atoms and two carbonyl groups. This compound is typically a white crystalline solid that is soluble in water and various organic solvents, making it versatile for different applications. It has a melting point that varies depending on purity and form. The presence of the dimethyl groups contributes to its stability and influences its reactivity, particularly in biological systems. 1,3-Dimethylimidazolidine-2,4-dione is often used in the synthesis of pharmaceuticals and agrochemicals, as well as in the production of surfactants and other specialty chemicals. Its ability to act as a stabilizer and a reagent in various chemical reactions highlights its importance in organic synthesis. Additionally, it exhibits low toxicity, making it suitable for applications in food and cosmetic formulations. Overall, this compound is valued for its unique chemical properties and functional versatility in various industrial applications.
Formula:C5H8N2O2
InChI:InChI=1/C5H8N2O2/c1-6-3-4(8)7(2)5(6)9/h3H2,1-2H3
- Synonyms:
- 2,4-Imidazolidinedione, 1,3-Dimethyl-
- 1,3-Dimethylimidazolidine-2,4-dione
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 1,3-dimethylimidazolidine-2,4-dione REF: 10-F512186CAS: 24039-08-5 | 95.0% | To inquire | Tue 29 Apr 25 |
![]() | 2,4-Imidazolidinedione, 1,3-dimethyl- REF: 3D-FI156580CAS: 24039-08-5 | Min. 95% | - - - | Discontinued product |

Ref: 10-F512186
2.5g | To inquire | ||
500mg | To inquire |

2,4-Imidazolidinedione, 1,3-dimethyl-
Ref: 3D-FI156580
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |