CymitQuimica logo

CAS 240401-35-8

:

3-Azabicyclo[3.2.1]octan-8-one

Description:
3-Azabicyclo[3.2.1]octan-8-one, also known as a bicyclic compound, features a unique structure characterized by a bicyclic framework that includes a nitrogen atom within the ring system. This compound is classified as a bicyclic amine due to the presence of the nitrogen atom, which contributes to its basicity and potential reactivity. The presence of a carbonyl group (ketone) at the 8-position enhances its chemical properties, making it a candidate for various synthetic applications. Typically, such compounds exhibit moderate solubility in polar solvents and may participate in nucleophilic reactions due to the electrophilic nature of the carbonyl carbon. The bicyclic structure can influence the compound's conformational flexibility and steric interactions, which are important in medicinal chemistry and drug design. Additionally, derivatives of this compound may exhibit biological activity, making it of interest in pharmacological research. Overall, 3-Azabicyclo[3.2.1]octan-8-one represents a versatile scaffold in organic synthesis and medicinal chemistry.
Formula:C7H11NO
InChI:InChI=1S/C7H11NO/c9-7-5-1-2-6(7)4-8-3-5/h5-6,8H,1-4H2
InChI key:LKWRGVRWBYLOFM-UHFFFAOYSA-N
SMILES:C1CC2CNCC1C2=O
Synonyms:
  • 3-Azabicyclo[3.2.1]octan-8-one(9CI)
  • 8-Oxo-3-Azabicyclo[3.2.1]Octane Hydrochloride
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.