CymitQuimica logo

CAS 240408-78-0

:

1,3,5-Triazine-2,4,6(1H,3H,5H)-trione,1,3,5-tris[(2R)-2-oxiranylmethyl]-

Description:
1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, 1,3,5-tris[(2R)-2-oxiranylmethyl]- is a chemical compound characterized by its triazine core, which features three nitrogen atoms in a six-membered ring structure. This compound contains three oxirane (epoxy) groups attached to the triazine framework, which enhances its reactivity and potential applications in polymer chemistry and materials science. The presence of the oxirane groups suggests that it can participate in ring-opening reactions, making it useful in the synthesis of various polymers and cross-linking agents. The compound is likely to exhibit properties typical of triazine derivatives, such as stability under certain conditions and potential biological activity. Its specific applications may include use in agrochemicals, pharmaceuticals, or as a building block in organic synthesis. As with many chemical substances, safety and handling precautions should be observed, particularly due to the reactive nature of the epoxide groups. Further studies would be necessary to fully elucidate its properties and potential uses.
Formula:C12H15N3O6
InChI:InChI=1S/C12H15N3O6/c16-10-13(1-7-4-19-7)11(17)15(3-9-6-21-9)12(18)14(10)2-8-5-20-8/h7-9H,1-6H2/t7-,8-,9-/m1/s1
InChI key:OUPZKGBUJRBPGC-IWSPIJDZSA-N
SMILES:C1[C@H](O1)CN2C(=O)N(C(=O)N(C2=O)C[C@@H]3CO3)C[C@@H]4CO4
Synonyms:
  • 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione,1,3,5-tris[(2R)-oxiranylmethyl]- (9CI)
Found 3 products.