CAS 24046-71-7
:trp-ala
Description:
The chemical substance known as "trp-ala," with the CAS number 24046-71-7, is a dipeptide composed of the amino acids tryptophan (Trp) and alanine (Ala). Dipeptides are formed through peptide bonds between the carboxyl group of one amino acid and the amino group of another. Tryptophan is an essential amino acid known for its role in protein synthesis and as a precursor for serotonin, a neurotransmitter. Alanine, a non-essential amino acid, plays a crucial role in energy production and metabolism. The characteristics of trp-ala include its solubility in water, which is typical for many peptides, and its potential biological activity, as dipeptides can exhibit various physiological effects. The specific properties, such as melting point, stability, and reactivity, can vary based on the conditions and environment in which the dipeptide is studied. Overall, trp-ala serves as an important model for understanding peptide behavior and interactions in biological systems.
Formula:C14H17N3O3
InChI:InChI=1/C14H17N3O3/c1-8(14(19)20)17-13(18)11(15)6-9-7-16-12-5-3-2-4-10(9)12/h2-5,7-8,11,16H,6,15H2,1H3,(H,17,18)(H,19,20)
SMILES:CC(C(=O)O)N=C(C(Cc1c[nH]c2ccccc12)N)O
Synonyms:- L-Tryptophyl-L-alanine
- Tryptophylalanine
- H-Trp-Ala-OH
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
H-Trp-Ala-OH TFA Salt
CAS:Controlled ProductApplications H-TRP-ALA-OH (cas# 24046-71-7) is a useful research chemical.
Formula:C14H17N3O3·x(C2HF3O2)Color and Shape:NeatMolecular weight:389.33H-Trp-Ala-OH
CAS:H-Trp-Ala-OH is a synthetic amino acid that has been used as an analytical reagent. The compound has shown antihypertensive activity in animal studies and can be used to prepare samples for chromatography or spectrophotometry. H-Trp-Ala-OH is soluble in water, but not in ethanol or ether. It has a neutral pH, and the carbonyl group makes it spontaneously fluorescent.
Formula:C14H17N3O3Purity:Min. 95%Molecular weight:275.3 g/molRef: 3D-FT108192
Discontinued product




