CAS 24049-18-1

sodium [3-chloro-4-(prop-2-en-1-yloxy)phenyl]acetate

Description:

Sodium [3-chloro-4-(prop-2-en-1-yloxy)phenyl]acetate, with the CAS number 24049-18-1, is an organic compound that features a phenyl ring substituted with a chloro group and an allyloxy group, along with an acetate moiety. This compound is typically characterized by its solubility in polar solvents due to the presence of the sodium salt form, which enhances its ionic nature. The chloro substituent can impart unique reactivity, making it useful in various chemical reactions, including nucleophilic substitutions. The allyloxy group provides potential for further functionalization, allowing for the synthesis of more complex molecules. This compound may exhibit biological activity, making it of interest in pharmaceutical and agrochemical research. Its stability under standard conditions is generally good, but it should be handled with care due to the presence of reactive functional groups. Overall, sodium [3-chloro-4-(prop-2-en-1-yloxy)phenyl]acetate is a versatile compound with applications in synthetic organic chemistry and potential biological significance.

Formula: C₁₁H₁₀ClNaO₃

InChI: InChI=1/C11H11ClO3.Na/c1-2-5-15-10-4-3-8(6-9(10)12)7-11(13)14;/h2-4,6H,1,5,7H2,(H,13,14);/q;+1/p-1

Alclofenac sodium

CAS: 24049-18-1

Alclofenac sodium is an anti-inflammatory utilized in the treatment of rheumatoid arthritis.

Formula: C₁₁H₁₁ClNaO₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 249.65

Ref: TM-T25036