CymitQuimica logo

CAS 24050-49-5

:

3-Bromo-1,8-naphthalic anhydride

Description:
3-Bromo-1,8-naphthalic anhydride is an organic compound characterized by its anhydride functional group and a bromine substituent on the naphthalene ring. It is a derivative of naphthalene, which consists of two fused benzene rings, and the presence of the anhydride group indicates that it can participate in various chemical reactions, particularly those involving nucleophiles. This compound is typically a solid at room temperature and may exhibit a crystalline structure. It is known for its reactivity, especially in the formation of derivatives through reactions with amines, alcohols, and other nucleophiles, making it useful in organic synthesis and materials science. The bromine atom enhances its electrophilic character, allowing for further functionalization. Additionally, 3-bromo-1,8-naphthalic anhydride may have applications in the development of dyes, pharmaceuticals, and agrochemicals due to its ability to form complex structures. Safety precautions should be taken when handling this compound, as it may pose health risks if inhaled or ingested.
Formula:C12H5BrO3
InChI:InChI=1/C12H5BrO3/c13-7-4-6-2-1-3-8-10(6)9(5-7)12(15)16-11(8)14/h1-5H
InChI key:LYXFXCSFCWZGNZ-UHFFFAOYSA-N
SMILES:c1cc2cc(cc3c2c(c1)C(=O)OC3=O)Br
Synonyms:
  • 5-bromo-1H,3H-benzo[de]isochromene-1,3-dione
Found 6 products.