CAS 24058-92-2

1,5-diphenyl-1H-1,2,4-triazole-3-carboxylate

Description:

1,5-Diphenyl-1H-1,2,4-triazole-3-carboxylate is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This substance features two phenyl groups attached to the 1 and 5 positions of the triazole ring, contributing to its aromatic properties and potential for various interactions. The carboxylate functional group at the 3-position enhances its solubility in polar solvents and may influence its reactivity and biological activity. This compound is often studied for its potential applications in pharmaceuticals, agrochemicals, and as a ligand in coordination chemistry due to its ability to form complexes with metal ions. Its unique structure allows for diverse chemical behavior, making it of interest in various fields, including medicinal chemistry and materials science. Safety data and handling precautions should be observed, as with all chemical substances, to ensure safe usage in laboratory and industrial settings.

Formula: C₁₅H₁₀N₃O₂

InChI: InChI=1/C15H11N3O2/c19-15(20)13-16-14(11-7-3-1-4-8-11)18(17-13)12-9-5-2-6-10-12/h1-10H,(H,19,20)/p-1

SMILES: c1ccc(cc1)c1nc(C(=O)O)nn1c1ccccc1

Synonyms:

• 1H-1,2,4-triazole-3-carboxylic acid, 1,5-diphenyl-

Diphenyl-1H-1,2,4-triazole-3-carboxylic acid

CAS: 24058-92-2

Diphenyl-1H-1,2,4-triazole-3-carboxylic acid is a versatile compound that has various applications in different fields. It is commonly used as a co-substrate in the synthesis of other compounds, such as diminazene, furosemide, amprenavir, and fosamprenavir calcium. Additionally, it is utilized in the production of research chemicals and as an intermediate for the synthesis of fatty acids.

Formula: C₁₅H₁₁N₃O₂

Purity: Min. 95%

Molecular weight: 265.27 g/mol

Ref: 3D-ZAA05892