CymitQuimica logo

CAS 24063-28-3

:

4,5-dibromobenzene-1,2-dicarboxylic acid

Description:
4,5-Dibromobenzene-1,2-dicarboxylic acid, with the CAS number 24063-28-3, is an aromatic dicarboxylic acid characterized by the presence of two carboxylic acid groups (-COOH) and two bromine substituents on a benzene ring. This compound typically exhibits a crystalline solid form and is soluble in polar solvents due to the presence of the carboxylic acid groups. The bromine atoms introduce significant electronegativity, influencing the compound's reactivity and potential applications in organic synthesis and materials science. The presence of multiple functional groups allows for various chemical transformations, making it a useful intermediate in the synthesis of more complex organic molecules. Additionally, the compound's structure may impart specific physical properties, such as melting and boiling points, which are influenced by intermolecular interactions, including hydrogen bonding. Overall, 4,5-dibromobenzene-1,2-dicarboxylic acid serves as an important building block in the development of pharmaceuticals, agrochemicals, and other specialty chemicals.
Formula:C8H4Br2O4
InChI:InChI=1/C8H4Br2O4/c9-5-1-3(7(11)12)4(8(13)14)2-6(5)10/h1-2H,(H,11,12)(H,13,14)
InChI key:ZIRYHOLKTROMQO-UHFFFAOYSA-N
SMILES:c1c(c(cc(c1Br)Br)C(=O)O)C(=O)O
Found 4 products.