CAS 240816-28-8

2-ethoxy-4-(tributylstannanyl)-1,3-thiazole

Description:

2-Ethoxy-4-(tributylstannanyl)-1,3-thiazole is an organotin compound characterized by the presence of a thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen atoms. The compound features an ethoxy group, which contributes to its solubility and reactivity, and a tributylstannyl group, which is a tin-based moiety known for its applications in organic synthesis and as a stabilizer in various chemical processes. Organotin compounds like this one often exhibit unique properties, including potential biological activity and the ability to act as catalysts in polymerization reactions. The thiazole ring can participate in various chemical reactions, making this compound versatile in synthetic chemistry. Additionally, the presence of the tributylstannyl group may impart specific characteristics such as hydrophobicity and enhanced stability under certain conditions. Overall, 2-ethoxy-4-(tributylstannanyl)-1,3-thiazole is a compound of interest in both academic research and industrial applications, particularly in the fields of materials science and organic synthesis.

Formula: C₁₇H₃₃NOSSn

InChI: InChI=1/C5H6NOS.3C4H9.Sn/c1-2-7-5-6-3-4-8-5;3*1-3-4-2;/h4H,2H2,1H3;3*1,3-4H2,2H3;/rC17H33NOSSn/c1-5-9-12-21(13-10-6-2,14-11-7-3)16-15-20-17(18-16)19-8-4/h15H,5-14H2,1-4H3

SMILES: CCCC[Sn](CCCC)(CCCC)c1csc(n1)OCC

Synonyms:

• 2-Ethoxy-4-(tributylstannyl)-1,3-thiazole
• Thiazole, 2-ethoxy-4-(tributylstannyl)-
• 2-(Ethoxy)-4-(Trimethylstannyl)Thiazole

2-Ethoxy-4-(tributylstannyl)-1,3-thiazole

CAS: 240816-28-8

2-Ethoxy-4-(tributylstannyl)-1,3-thiazole

Purity: ≥95%

Molecular weight: 418.23g/mol

Ref: 54-OR15534