CAS 24083-19-0
:4-n-Dodecyloxybenzaldehyde
Description:
4-n-Dodecyloxybenzaldehyde is an organic compound characterized by its aromatic structure, featuring a benzaldehyde group substituted with a dodecyloxy chain at the para position. This compound typically exhibits a hydrophobic nature due to the long alkyl chain, which influences its solubility properties, making it more soluble in organic solvents than in water. The presence of the aldehyde functional group contributes to its reactivity, allowing it to participate in various chemical reactions, such as oxidation and condensation. Additionally, 4-n-Dodecyloxybenzaldehyde may display interesting thermal and phase transition properties, which can be relevant in materials science, particularly in the development of liquid crystals or surfactants. Its molecular structure can lead to unique interactions in biological systems, making it a candidate for studies in biochemistry and pharmacology. Overall, this compound's characteristics make it valuable in both industrial applications and research settings, particularly in the synthesis of more complex organic molecules.
Formula:C19H30O2
InChI:InChI=1/C19H30O2/c1-2-3-4-5-6-7-8-9-10-11-16-21-19-14-12-18(17-20)13-15-19/h12-15,17H,2-11,16H2,1H3
SMILES:CCCCCCCCCCCCOc1ccc(cc1)C=O
Synonyms:- p-Dodecyloxybenzaldehyde
- 4-(Dodecyloxy)Benzaldehyde
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4-n-Dodecyloxybenzaldehyde, 98%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C19H30O2Purity:98%Color and Shape:Fused solid, White to yellowMolecular weight:290.454-(Dodecyloxy)benzaldehyde
CAS:Formula:C19H30O2Purity:98%Color and Shape:LiquidMolecular weight:290.44034-[(Dodec-1-yl)oxy]benzaldehyde
CAS:4-[(Dodec-1-yl)oxy]benzaldehydePurity:95%Molecular weight:290.44g/molp-Dodecyloxybenzaldehyde
CAS:Formula:C19H30O2Purity:98%Color and Shape:No data available.Molecular weight:290.447p-Dodecyloxybenzaldehyde
CAS:Versatile small molecule scaffoldFormula:C19H30O2Purity:Min. 95%Molecular weight:290.4 g/mol




