CAS 24088-81-1

6-Chloroisatoic anhydride

Description:

6-Chloroisatoic anhydride is a chemical compound characterized by its anhydride functional group, which is derived from isatoic acid. It features a chloro substituent at the 6-position of the isatoic acid structure, contributing to its reactivity and potential applications in organic synthesis. This compound is typically a white to off-white solid and is known for its role as a reagent in various chemical reactions, particularly in the synthesis of heterocyclic compounds and as an acylating agent. Its reactivity is influenced by the presence of the anhydride group, which can undergo hydrolysis in the presence of water, leading to the formation of isatoic acid. Additionally, 6-chloroisatoic anhydride may exhibit biological activity, making it of interest in pharmaceutical research. As with many chemical substances, proper handling and safety precautions are essential due to its potential hazards. Overall, 6-chloroisatoic anhydride is a valuable compound in synthetic organic chemistry with diverse applications.

Formula: C₈H₄ClNO₃

InChI: InChI=1/C8H4ClNO3/c9-4-1-2-6-5(3-4)7(11)10-8(12)13-6/h1-3H,(H,10,11,12)

Synonyms:

• 6-chloro-2H-3,1-benzoxazine-2,4(1H)-dione
• 6-chloro-2H-1,3-benzoxazine-2,4(3H)-dione

6-Chloro-2H-benzo[e][1,3]oxazine-2,4(3H)-dione

CAS: 24088-81-1

6-Chloro-2H-benzo[e][1,3]oxazine-2,4(3H)-dione

Purity: 98%

Ref: 54-OR1077247

6-Chloro-2H-benzo[e][1,3]oxazine-2,4(3H)-dione

CAS: 24088-81-1

Purity: 98%

Molecular weight: 197.5700073

Ref: 10-F619071

6-Chloro-3,4-dihydro-2H-1,3-benzoxazine-2,4-dione

CAS: 24088-81-1

Versatile small molecule scaffold

Formula: C₈H₄ClNO₃

Purity: Min. 95%

Molecular weight: 197.6 g/mol

Ref: 3D-ZAA08881