CAS 2410-28-8: 1,2-Dioleoyl-3-stearoylglycerol
Description:1,2-Dioleoyl-3-stearoylglycerol, with the CAS number 2410-28-8, is a glycerolipid that belongs to the class of triacylglycerols. This compound features two oleic acid chains and one stearic acid chain esterified to a glycerol backbone, which contributes to its unique physical and chemical properties. It is typically a solid at room temperature due to the presence of the saturated stearic acid, while the unsaturated oleic acids provide fluidity. This lipid is of interest in various fields, including biochemistry and food science, due to its role in membrane structure and function, as well as its potential applications in drug delivery systems and as an emulsifier. Its amphiphilic nature allows it to interact with both hydrophilic and hydrophobic environments, making it useful in formulations that require stabilization of oil-water mixtures. Additionally, it can be involved in metabolic processes and is studied for its effects on health and nutrition.
Formula:C57H106O6
InChI:InChI=1/C57H106O6/c1-4-7-10-13-16-19-22-25-28-31-34-37-40-43-46-49-55(58)61-52-54(63-57(60)51-48-45-42-39-36-33-30-27-24-21-18-15-12-9-6-3)53-62-56(59)50-47-44-41-38-35-32-29-26-23-20-17-14-11-8-5-2/h25,27-28,30,54H,4-24,26,29,31-53H2,1-3H3/b28-25-,30-27-
InChI key:InChIKey=RYNHWWNZNIGDAQ-CDAVXRBQNA-N
SMILES:O=C(OCC(OC(=O)CCCCCCCC=CCCCCCCCC)COC(=O)CCCCCCCCCCCCCCCCC)CCCCCCCC=CCCCCCCCC
- Synonyms:
- 9-Octadecenoic acid (Z)-, 1-[[(1-oxooctadecyl)oxy]methyl]-1,2-ethanediyl ester
- Olein, 3-stearo-1,2-di-
- Stearin, 2,3-dioleo-1-
- 9-Octadecenoic acid (9Z)-, 1,1′-[1-[[(1-oxooctadecyl)oxy]methyl]-1,2-ethanediyl] ester
- 9-Octadecenoic acid (9Z)-, 1-[[(1-oxooctadecyl)oxy]methyl]-1,2-ethanediyl ester