CAS 2410-60-8
:18-Oxocortisol
Description:
18-Oxocortisol, with the CAS number 2410-60-8, is a steroid hormone that is a derivative of cortisol, which plays a crucial role in various physiological processes, including metabolism and immune response regulation. It is characterized by its ketone functional group at the 18th carbon position, which distinguishes it from other corticosteroids. This compound is typically found in the adrenal cortex and is involved in the biosynthesis of other steroid hormones. 18-Oxocortisol exhibits biological activity similar to cortisol, influencing glucose metabolism and exhibiting anti-inflammatory properties. Its structure includes a steroid nucleus, which consists of four fused carbon rings, and it is soluble in organic solvents but less so in water. The compound is of interest in clinical research and endocrinology, particularly in studies related to adrenal function and disorders. Understanding its characteristics and functions can provide insights into steroid hormone regulation and potential therapeutic applications.
Formula:C21H28O6
InChI:InChI=1S/C21H28O6/c1-19-6-4-13(24)8-12(19)2-3-14-15-5-7-21(27,17(26)10-22)20(15,11-23)9-16(25)18(14)19/h8,11,14-16,18,22,25,27H,2-7,9-10H2,1H3/t14-,15-,16-,18+,19-,20+,21-/m0/s1
InChI key:InChIKey=XUQWWIFROYJHCU-UKSDXMLSSA-N
SMILES:C(=O)[C@@]12[C@]([C@]3([C@]([C@@H](O)C1)([C@]4(C)C(CC3)=CC(=O)CC4)[H])[H])(CC[C@@]2(C(CO)=O)O)[H]
Synonyms:- (11β)-11,17,21-Trihydroxy-3,20-dioxopregn-4-en-18-al
- 11b,17,21-Trihydroxy-3,20-dioxo-pregn-4-en-18-al
- 11beta,17alpha,21-Trihydroxy-3,20-diketo-4-pregnene-18-al
- 18-Oxocortisol
- Pregn-4-En-18-Al, 11,17,21-Trihydroxy-3,20-Dioxo-, (11Beta)-
- Pregn-4-en-18-al, 11,17,21-trihydroxy-3,20-dioxo-, (11β)-
- Pregn-4-en-18-al, 11β,17,21-trihydroxy-3,20-dioxo-
- (11beta)-11,17,21-Trihydroxy-3,20-dioxopregn-4-en-18-al
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
18-Oxocortisol
CAS:<p>18-Oxocortisol, a naturally occurring mineralocorticoid and adrenal biomarker, is produced by CYP11B2.</p>Formula:C21H28O6Color and Shape:SolidMolecular weight:376.44918-Oxocortisol
CAS:<p>Applications 18-Oxocortisol is used in biological studies on anti-malarial drug artesunate restoring metabolic changes in experimental allergic astham.<br>References Ho, W., et al.: Metabolomics, 11, 380 (2015);<br></p>Formula:C21H28O6Color and Shape:White To Off-WhiteMolecular weight:376.44

