
CAS 24100-20-7
:5-[(Methylsulfonyl)methyl]-1H-imidazole
Description:
5-[(Methylsulfonyl)methyl]-1H-imidazole, with the CAS number 24100-20-7, is an organic compound characterized by its imidazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms. This compound features a methylsulfonyl group attached to a methylene bridge, contributing to its unique chemical properties. It is typically a white to off-white solid and is soluble in polar solvents, reflecting its polar functional groups. The presence of the methylsulfonyl moiety enhances its potential for biological activity, making it of interest in pharmaceutical research. The compound may exhibit properties such as antimicrobial or antifungal activity, although specific biological effects can vary based on structural modifications and environmental conditions. Its stability under standard conditions and reactivity with various nucleophiles or electrophiles can also be significant in synthetic applications. Overall, 5-[(Methylsulfonyl)methyl]-1H-imidazole serves as a valuable building block in organic synthesis and medicinal chemistry.
Formula:C5H8N2O2S
InChI:InChI=1S/C5H8N2O2S/c1-10(8,9)3-5-2-6-4-7-5/h2,4H,3H2,1H3,(H,6,7)
InChI key:InChIKey=CBDWAVCHRCHJGH-UHFFFAOYSA-N
SMILES:C(S(C)(=O)=O)C1=CN=CN1
Synonyms:- Imidazole, 4-[(methylsulfonyl)methyl]-
- 5-[(Methylsulfonyl)methyl]-1H-imidazole
- 1H-Imidazole, 5-[(methylsulfonyl)methyl]-
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery