CymitQuimica logo

CAS 24102-11-2

:

2-Propyl-4-pentynoic acid

Description:
2-Propyl-4-pentynoic acid, with the CAS number 24102-11-2, is an organic compound characterized by its alkyne functional group and carboxylic acid moiety. It features a five-carbon chain with a triple bond located between the fourth and fifth carbon atoms, and a propyl group attached to the second carbon. This structure imparts unique properties, including its potential as a building block in organic synthesis and its reactivity due to the presence of the alkyne. The compound is typically a colorless to pale yellow liquid, exhibiting moderate solubility in organic solvents while being less soluble in water due to its hydrophobic carbon chain. Its boiling point and melting point are influenced by the molecular structure and the presence of the carboxylic acid group, which can participate in hydrogen bonding. 2-Propyl-4-pentynoic acid may be utilized in various chemical reactions, including esterification and alkylation, making it valuable in the synthesis of more complex organic molecules. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C8H12O2
InChI:InChI=1S/C8H12O2/c1-3-5-7(6-4-2)8(9)10/h1,7H,4-6H2,2H3,(H,9,10)
InChI key:InChIKey=KWBNQXQUIZBELR-UHFFFAOYSA-N
SMILES:C(CCC)(CC#C)C(O)=O
Synonyms:
  • 2-n-Propyl-4-pentynoic acid
  • (±)-2-n-Propyl-4-pentynoic acid
  • 4-Pentynoic acid, 2-propyl-
  • 2-Propyl-4-pentynoic acid
Found 0 products.