CAS 24103-75-1

4-Methoxy-2-methylpyridine

Description:

4-Methoxy-2-methylpyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a methoxy group (-OCH3) at the 4-position and a methyl group (-CH3) at the 2-position contributes to its unique chemical properties. This compound is typically a colorless to pale yellow liquid with a distinctive odor. It is soluble in organic solvents and exhibits moderate polarity due to the methoxy group. 4-Methoxy-2-methylpyridine can participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, making it useful in organic synthesis and as an intermediate in the production of pharmaceuticals and agrochemicals. Additionally, it may exhibit biological activity, which can be of interest in medicinal chemistry. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₇H₉NO

InChI: InChI=1/C7H9NO/c1-6-5-7(9-2)3-4-8-6/h3-5H,1-2H3

SMILES: Cc1cc(ccn1)OC

Synonyms:

• Pyridine, 4-Methoxy-2-Methyl-

4-Methoxy-2-methylpyridine

CAS: 24103-75-1

Formula: C₇H₉NO

Purity: 98%

Color and Shape: Liquid

Molecular weight: 123.1525

Ref: IN-DA006XDE

4-Methoxy-2-methylpyridine

CAS: 24103-75-1

4-Methoxy-2-methylpyridine

Purity: 98%

Molecular weight: 123.15246g/mol

Ref: 54-OR305550

4-Methoxy-2-methylpyridine

CAS: 24103-75-1

Formula: C₇H₉NO

Purity: 95%

Color and Shape: Liquid

Molecular weight: 123.155

Ref: 10-F233947

4-Methoxy-2-methylpyridine

CAS: 24103-75-1

Versatile small molecule scaffold

Formula: C₇H₉NO

Purity: Min. 95%

Molecular weight: 123.15 g/mol

Ref: 3D-ZAA10375