CAS 24107-34-4
:2,2,4-trimethyl-2,3-dihydro-1H-1,5-benzodiazepine
Description:
2,2,4-Trimethyl-2,3-dihydro-1H-1,5-benzodiazepine, with the CAS number 24107-34-4, is a chemical compound belonging to the benzodiazepine class, which is known for its psychoactive properties. This compound features a fused benzene and diazepine ring structure, characterized by the presence of two nitrogen atoms in the diazepine ring. The trimethyl groups contribute to its unique steric and electronic properties, potentially influencing its biological activity and solubility. Typically, benzodiazepines exhibit anxiolytic, sedative, and muscle relaxant effects, although the specific pharmacological profile of this compound may vary. Its molecular structure suggests potential interactions with the central nervous system, but detailed studies on its efficacy, safety, and mechanism of action are necessary to fully understand its characteristics. Additionally, the compound's stability, reactivity, and potential applications in medicinal chemistry or pharmacology would depend on further research and characterization. As with all chemical substances, handling should be conducted with appropriate safety measures in place.
Formula:C12H16N2
InChI:InChI=1/C12H16N2/c1-9-8-12(2,3)14-11-7-5-4-6-10(11)13-9/h4-7,14H,8H2,1-3H3
SMILES:CC1=Nc2ccccc2NC(C)(C)C1
Synonyms:- 1H-1,5-benzodiazepine, 2,3-dihydro-2,2,4-trimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2,2,4-Trimethyl-2,3-dihydro-1H-1,5-benzodiazepine
CAS:2,2,4-Trimethyl-2,3-dihydro-1H-1,5-benzodiazepinePurity:techMolecular weight:188.27g/mol
