CAS 24112-57-0: (2E,4E,6Z,8E,10E,12E,14E)-N,N'-bis(2-hydroxy-5-oxocyclopent-1-en-1-yl)hexadeca-2,4,6,8,10,12,14-heptaenediamide
Description:The chemical substance known as "(2E,4E,6Z,8E,10E,12E,14E)-N,N'-bis(2-hydroxy-5-oxocyclopent-1-en-1-yl)hexadeca-2,4,6,8,10,12,14-heptaenediamide" with CAS number 24112-57-0 is a complex organic compound characterized by its long carbon chain and multiple double bonds, which contribute to its unsaturated nature. The presence of the amide functional groups indicates potential for hydrogen bonding, influencing its solubility and reactivity. The compound features a series of conjugated double bonds, which can impart unique optical properties and stability against certain chemical reactions. Additionally, the hydroxyl groups suggest that it may exhibit polar characteristics, enhancing its interaction with other polar substances. Its structural complexity may also indicate potential biological activity, making it of interest in fields such as medicinal chemistry or materials science. Overall, this compound's unique structural features and functional groups contribute to its potential applications and reactivity in various chemical contexts.
Formula:C26H26N2O6
InChI:InChI=1/C26H26N2O6/c29-19-15-16-20(30)25(19)27-23(33)13-11-9-7-5-3-1-2-4-6-8-10-12-14-24(34)28-26-21(31)17-18-22(26)32/h1-14,29,31H,15-18H2,(H,27,33)(H,28,34)/b2-1+,5-3-,6-4+,9-7+,10-8+,13-11+,14-12+
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Limocrocin REF: TM-T25729CAS: 24112-57-0 | 98% | 1,094.00 €~2,945.00 € | Tue 08 Jul 25 |

Limocrocin
Ref: TM-T25729
25mg | 1,730.00 € | ||
50mg | 2,262.00 € | ||
100mg | 2,945.00 € |