CAS 241127-58-2

4-(2,5-Dihydroxybenzylamino)benzoic acid 1-adamantyl ester

Description:

4-(2,5-Dihydroxybenzylamino)benzoic acid 1-adamantyl ester, with the CAS number 241127-58-2, is a chemical compound characterized by its complex structure, which includes an adamantyl group, a benzoic acid moiety, and a dihydroxybenzylamino substituent. This compound typically exhibits properties associated with both hydrophilicity and hydrophobicity due to the presence of hydroxyl groups and the bulky adamantyl group, respectively. The hydroxyl groups can participate in hydrogen bonding, influencing its solubility and reactivity. The benzoic acid component may contribute to acidic properties, while the adamantyl group can enhance lipophilicity, potentially affecting the compound's biological activity and membrane permeability. Such compounds are often studied for their potential applications in pharmaceuticals, particularly in drug design and development, due to their ability to interact with biological targets. Additionally, the presence of multiple functional groups allows for further chemical modifications, making it a versatile candidate for various synthetic applications.

Formula: C₂₄H₂₇NO₄

InChI: InChI=1/C24H27NO4/c26-21-5-6-22(27)19(10-21)14-25-20-3-1-18(2-4-20)23(28)29-24-11-15-7-16(12-24)9-17(8-15)13-24/h1-6,10,15-17,25-27H,7-9,11-14H2

SMILES: c1cc(ccc1C(=O)OC12CC3CC(CC(C3)C2)C1)NCc1cc(ccc1O)O

Synonyms:

• Adaphostin
• Nsc-680410
• Tricyclo[3.3.1.1~3,7~]Dec-1-Yl 4-[(2,5-Dihydroxybenzyl)Amino]Benzoate

Adaphostin

CAS: 241127-58-2

Adaphostin

Purity: ≥95%

Molecular weight: 393.48g/mol

Ref: 54-BUP06357

Adaphostin

CAS: 241127-58-2

Adaphostin (NSC-680410) is a p210Bcr/Abl tyrosine kinase inhibitor with IC50 of 14 μM.

Formula: C₂₄H₂₇NO₄

Purity: 98.29%

Color and Shape: Solid

Molecular weight: 393.48

Ref: TM-T22553

Adaphostin

Controlled Product

CAS: 241127-58-2

Formula: C₂₄H₂₇NO₄

Color and Shape: Neat

Molecular weight: 393.476

Ref: TR-A225020