CAS 241127-79-7

Tricyclo[3.3.1.13,7]dec-1-ylmethyl 4-[[(2,5-dihydroxyphenyl)methyl]amino]benzoate

Description:

Tricyclo[3.3.1.13,7]dec-1-ylmethyl 4-[[(2,5-dihydroxyphenyl)methyl]amino]benzoate, with CAS number 241127-79-7, is a complex organic compound characterized by its unique tricyclic structure and functional groups. This substance features a tricyclodecane framework, which contributes to its rigidity and potential steric effects. The presence of a benzoate moiety indicates that it has an ester functional group, which can influence its solubility and reactivity. Additionally, the incorporation of a 2,5-dihydroxyphenyl group suggests potential for hydrogen bonding and interactions with biological targets, making it of interest in medicinal chemistry. The amino group in the structure may also enhance its ability to form salts or participate in various chemical reactions. Overall, the compound's structural complexity and functional diversity may confer unique properties, making it a candidate for further investigation in pharmaceutical applications or material science. However, specific physical and chemical properties such as melting point, solubility, and reactivity would require empirical data for comprehensive characterization.

Formula: C₂₅H₂₉NO₄

InChI: InChI=1S/C25H29NO4/c27-22-5-6-23(28)20(10-22)14-26-21-3-1-19(2-4-21)24(29)30-15-25-11-16-7-17(12-25)9-18(8-16)13-25/h1-6,10,16-18,26-28H,7-9,11-15H2

InChI key: InChIKey=MXKHJVTZHIIIMQ-UHFFFAOYSA-N

SMILES: C(OC(=O)C1=CC=C(NCC2=C(O)C=CC(O)=C2)C=C1)C34CC5CC(C3)CC(C4)C5

Synonyms:

• NSC 689857
• Tricyclo[3.3.1.13,7]dec-1-ylmethyl 4-[[(2,5-dihydroxyphenyl)methyl]amino]benzoate
• Benzoic acid, 4-[[(2,5-dihydroxyphenyl)methyl]amino]-, tricyclo[3.3.1.13,7]dec-1-ylmethyl ester

NSC-689857

CAS: 241127-79-7

NSC-689857 is an inhibitor that acts in the Skp2-Cks1 protein-protein interaction and p27Kip1 ubiquitination in vitro.

Formula: C₂₅H₂₉NO₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 407.5

Ref: TM-T25889