
CAS 241132-37-6
:N-[(6-Chloroimidazo[2,1-b]thiazol-5-yl)methylene]benzenamine
Description:
N-[(6-Chloroimidazo[2,1-b]thiazol-5-yl)methylene]benzenamine is a chemical compound characterized by its complex structure, which includes an imidazo-thiazole moiety and a benzene amine group. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity due to the presence of nitrogen and sulfur in its structure. The chloro substituent on the imidazo-thiazole ring may influence its reactivity and solubility, while the methylene bridge connects the imidazo-thiazole to the aniline part of the molecule, potentially affecting its electronic properties. Such compounds are often investigated for their pharmacological properties, including antimicrobial or anticancer activities. The presence of multiple functional groups suggests that it may participate in various chemical reactions, making it of interest in medicinal chemistry and drug development. Additionally, its specific interactions with biological targets would depend on its three-dimensional conformation and the electronic distribution within the molecule.
Formula:C12H8ClN3S
InChI:InChI=1S/C12H8ClN3S/c13-11-10(16-6-7-17-12(16)15-11)8-14-9-4-2-1-3-5-9/h1-8H
InChI key:InChIKey=CSBYORUDPIZQTG-UHFFFAOYSA-N
SMILES:C(=NC1=CC=CC=C1)C=2N3C(=NC2Cl)SC=C3
Synonyms:- N-[(6-Chloroimidazo[2,1-b]thiazol-5-yl)methylene]benzenamine
- Benzenamine, N-[(6-chloroimidazo[2,1-b]thiazol-5-yl)methylene]-
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery