CAS 24124-04-7
:diethyl hydroxy(propan-2-yl)propanedioate
Description:
Diethyl hydroxy(propan-2-yl)propanedioate, with the CAS number 24124-04-7, is an organic compound characterized by its ester functional groups and a hydroxy group. This compound features a diethyl ester of a dicarboxylic acid, specifically propanedioic acid, which is further substituted with a hydroxy group and an isopropyl group. The presence of these functional groups contributes to its solubility in organic solvents and its potential reactivity in various chemical reactions, such as esterification and hydrolysis. The hydroxy group can also participate in hydrogen bonding, influencing the compound's physical properties, such as boiling and melting points. Diethyl hydroxy(propan-2-yl)propanedioate may be utilized in synthetic organic chemistry, particularly in the synthesis of more complex molecules or as an intermediate in various chemical processes. Its safety and handling should be approached with caution, as with many organic compounds, due to potential toxicity and environmental impact.
Formula:C10H18O5
InChI:InChI=1/C10H18O5/c1-5-14-8(11)10(13,7(3)4)9(12)15-6-2/h7,13H,5-6H2,1-4H3
SMILES:CCOC(=O)C(C(C)C)(C(=O)OCC)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Isopropyl-tartronic Acid Diethyl Ester
CAS:Controlled Product<p>Applications Used in the preparation of (+)-Lysergic acid and α-Ergocryptine (E597500).<br></p>Formula:C10H18O5Color and Shape:NeatMolecular weight:218.25
