CAS 24134-09-6
:5-bromo-1,2-dimethyl-1H-imidazole
Description:
5-Bromo-1,2-dimethyl-1H-imidazole is a heterocyclic organic compound characterized by its imidazole ring, which contains two nitrogen atoms in a five-membered ring structure. The presence of a bromine atom at the 5-position and two methyl groups at the 1 and 2 positions contributes to its unique chemical properties. This compound is typically a colorless to pale yellow solid, and it is soluble in polar organic solvents. Its molecular structure allows for potential applications in pharmaceuticals, agrochemicals, and as a building block in organic synthesis. The bromine substituent can enhance reactivity, making it useful in various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the imidazole ring is known for its biological activity, often found in biologically active molecules, which may suggest potential pharmacological applications. Safety data should be consulted for handling and storage, as halogenated compounds can pose health risks. Overall, 5-bromo-1,2-dimethyl-1H-imidazole is a versatile compound with significant implications in both research and industry.
Formula:C5H7BrN2
InChI:InChI=1/C5H7BrN2/c1-4-7-3-5(6)8(4)2/h3H,1-2H3
SMILES:Cc1ncc(Br)n1C
Synonyms:- 1H-Imidazole,5-bromo-1,2-dimethyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
5-Bromo-1,2-dimethyl-1H-imidazole
CAS:Formula:C5H7BrN2Purity:98%Color and Shape:SolidMolecular weight:175.02655-Bromo-1,2-dimethyl-1H-imidazole
CAS:5-Bromo-1,2-dimethyl-1H-imidazoleFormula:C5H7BrN2Purity:97%Color and Shape: beige solidMolecular weight:175.03g/mol5-Bromo-1,2-dimethyl-1H-imidazole
CAS:Formula:C5H7BrN2Purity:98%Color and Shape:SolidMolecular weight:175.0295-Bromo-1,2-dimethyl-1H-imidazole
CAS:5-Bromo-1,2-dimethyl-1H-imidazole is a versatile compound with a range of applications in various industries. It is commonly used in the production of research chemicals, such as indolin-2-one and picroside. Additionally, it is utilized in the synthesis of dyes like pararosaniline. This compound also finds application in the field of medicine. It can be used as a precursor in the synthesis of pharmaceuticals like sulfisoxazole and dacarbazine. Furthermore, 5-Bromo-1,2-dimethyl-1H-imidazole has been studied for its potential as an electrode material due to its unique properties. In addition to its medical and scientific applications, this compound has been explored for its use in various chemical processes. It has been found to act as a solid catalyst in certain reactions and can be employed in collagenase assays. Its versatility extends further to fields like agriculture and food science, where it may find useFormula:C5H7BrN2Purity:Min. 95%Molecular weight:175.03 g/mol



