CAS 24140-98-5

4-(8-chlorodibenzo[b,f]oxepin-10-yl)-1-methylpiperazin-1-ium (2Z)-3-carboxyprop-2-enoate

Description:

4-(8-Chlorodibenzo[b,f]oxepin-10-yl)-1-methylpiperazin-1-ium (2Z)-3-carboxyprop-2-enoate, with CAS number 24140-98-5, is a chemical compound that belongs to the class of piperazine derivatives. This substance features a complex structure characterized by the presence of a dibenzo[b,f]oxepin moiety, which contributes to its potential pharmacological properties. The compound is likely to exhibit amphoteric behavior due to the presence of both a quaternary ammonium group and a carboxylic acid functional group, allowing it to interact with various biological targets. Its chlorinated aromatic system may enhance lipophilicity, potentially influencing its bioavailability and interaction with cellular membranes. The compound's unique structural features suggest it may have applications in medicinal chemistry, particularly in the development of therapeutic agents. However, specific biological activities, solubility, stability, and toxicity profiles would require further investigation to fully understand its potential uses and safety considerations in pharmaceutical applications.

Formula: C₂₃H₂₃ClN₂O₅

InChI: InChI=1/C19H19ClN2O.C4H4O4/c1-21-8-10-22(11-9-21)17-12-14-4-2-3-5-18(14)23-19-7-6-15(20)13-16(17)19;5-3(6)1-2-4(7)8/h2-7,12-13H,8-11H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1-

SMILES: CN1CCN(CC1)C1=Cc2ccccc2Oc2ccc(cc12)Cl.C(=C\C(=O)O)\C(=O)O

2-CMDO

CAS: 24140-98-5

2-CMDO is a Dopamine D2-like receptor antagonist.

Formula: C₂₃H₂₃ClN₂O₅

Purity: 98%

Color and Shape: Solid

Molecular weight: 442.89

Ref: TM-T22493