CymitQuimica logo

CAS 241488-18-6

:

Methyl 3-[5-[[[(3,4-dichlorophenyl)methoxy]imino]methyl]-2-furanyl]-2-thiophenecarboxylate

Description:
Methyl 3-[5-[[[(3,4-dichlorophenyl)methoxy]imino]methyl]-2-furanyl]-2-thiophenecarboxylate, identified by its CAS number 241488-18-6, is a complex organic compound characterized by its unique structural features. It contains a methyl ester functional group, a thiophene ring, and a furan moiety, which contribute to its potential biological activity. The presence of the 3,4-dichlorophenyl group suggests that it may exhibit significant lipophilicity, influencing its solubility and interaction with biological membranes. The imino group indicates potential reactivity, possibly allowing for further chemical modifications. This compound may be of interest in medicinal chemistry due to its structural diversity, which could lead to various pharmacological properties. Additionally, the presence of halogen atoms, such as chlorine, often enhances the compound's biological activity or stability. Overall, the characteristics of this compound suggest it may have applications in drug development or as a research tool in organic synthesis and medicinal chemistry.
Formula:C18H13Cl2NO4S
InChI:InChI=1S/C18H13Cl2NO4S/c1-23-18(22)17-13(6-7-26-17)16-5-3-12(25-16)9-21-24-10-11-2-4-14(19)15(20)8-11/h2-9H,10H2,1H3
InChI key:InChIKey=SZINKJSOFQRJRN-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=C(C=CS1)C=2OC(C=NOCC3=CC(Cl)=C(Cl)C=C3)=CC2
Synonyms:
  • Methyl 3-[5-[[[(3,4-dichlorophenyl)methoxy]imino]methyl]-2-furanyl]-2-thiophenecarboxylate
  • 2-Thiophenecarboxylic acid, 3-[5-[[[(3,4-dichlorophenyl)methoxy]imino]methyl]-2-furanyl]-, methyl ester
Found 0 products.