CAS 24154-37-8

2,4,6-triiodoaniline

Description:

2,4,6-Triiodoaniline is an organic compound characterized by the presence of three iodine atoms attached to the benzene ring of an aniline molecule. Its chemical formula is C6H3I3N, indicating that it contains six carbon atoms, three hydrogen atoms, three iodine atoms, and one nitrogen atom. This compound is typically a solid at room temperature and is known for its dark color due to the presence of iodine. It is often used in various applications, including as a reagent in organic synthesis and in the production of dyes and pigments. The presence of iodine atoms significantly influences its chemical reactivity and physical properties, such as solubility and melting point. Additionally, 2,4,6-triiodoaniline can exhibit biological activity, making it of interest in medicinal chemistry and research. Safety precautions should be taken when handling this compound, as iodine can be hazardous in certain forms. Overall, 2,4,6-triiodoaniline is a notable compound in both industrial and research contexts due to its unique properties and applications.

Formula: C₆H₄I₃N

InChI: InChI=1/C6H4I3N/c7-3-1-4(8)6(10)5(9)2-3/h1-2H,10H2

SMILES: c1c(cc(c(c1I)N)I)I

Synonyms:

• 2,4,6-Triiodo-Phenylamine
• Benzenamine, 2,4,6-Triiodo-

2,4,6-Triiodo-phenylamine

CAS: 24154-37-8

Formula: C₆H₄I₃N

Purity: 97%

Color and Shape: Solid

Molecular weight: 470.8161

Ref: IN-DA007O4M

2,4,6-Triiodoaniline

CAS: 24154-37-8

2,4,6-Triiodoaniline

Purity: ≥95%

Color and Shape: Solid

Molecular weight: 470.82g/mol

Ref: 54-OR17664

2,4,6-triiodoaniline

Controlled Product

CAS: 24154-37-8

Formula: C₆H₄I₃N

Color and Shape: Beige To Dark Brown

Molecular weight: 470.816

Ref: TR-T207821

2,4,6-triiodoaniline

CAS: 24154-37-8

Purity: 97%

Molecular weight: 470.8179932

Ref: 10-F870736