CAS 24155-47-3
:2-(1H-Imidazol-1-yl)-1-phenylethanol
Description:
2-(1H-Imidazol-1-yl)-1-phenylethanol, with the CAS number 24155-47-3, is an organic compound characterized by its imidazole and phenyl functional groups. This compound features a hydroxyl (-OH) group attached to a carbon chain that connects a phenyl group and an imidazole ring, which contributes to its potential biological activity. The presence of the imidazole moiety suggests that it may exhibit properties relevant to medicinal chemistry, as imidazole derivatives are often found in pharmaceuticals. The compound is likely to be a solid at room temperature, with moderate solubility in polar solvents due to the hydroxyl group. Its structure may allow for hydrogen bonding, influencing its reactivity and interactions with other molecules. Additionally, the compound may exhibit chirality, depending on the configuration of the carbon atoms in the chain, which could affect its biological activity and pharmacokinetics. Overall, 2-(1H-Imidazol-1-yl)-1-phenylethanol is of interest for its potential applications in drug development and as a biochemical probe.
Formula:C11H12N2O
InChI:InChI=1S/C11H12N2O/c14-11(8-13-7-6-12-9-13)10-4-2-1-3-5-10/h1-7,9,11,14H,8H2
InChI key:InChIKey=NTWZHQAXJSJOIB-UHFFFAOYSA-N
SMILES:C(CN1C=CN=C1)(O)C2=CC=CC=C2
Synonyms:- 1H-Imidazole-1-ethanol, α-phenyl-
- 1H-imidazole-1-ethanol, alpha-phenyl-
- 2-(1H-Imidazol-1-yl)-1-phenylethan-1-ol
- 2-Imidazol-1-yl-1-phenylethanol
- Imidazole-1-ethanol, α-phenyl-
- α-Phenyl-1H-imidazole-1-ethanol
- 2-(1H-Imidazol-1-yl)-1-phenylethanol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
2-(1-Imidazolyl)-1-phenylethanol
CAS:2-(1-Imidazolyl)-1-phenylethanol is an insecticide that belongs to the carbamate class of compounds. It is a racemic mixture of two stereoisomers, 14α-demethylase and 14β-demethylase. 2-(1-Imidazolyl)-1-phenylethanol has been shown to have potent activity against protozoan parasites, such as Leishmania species and Plasmodium falciparum. This compound binds to the enzyme 14α-demethylase in the protozoan parasite and prevents the formation of cholesterol from acetate. The inhibition of this enzyme leads to a decrease in the production of cell membranes, which causes cell death. 2-(1-Imidazolyl)-1-phenylethanol has also been shown to inhibit human monocytic cells by binding to their 14β-demethylase and blocking cholesterol synthesis.Formula:C11H12N2OPurity:Min. 95%Molecular weight:188.23 g/mol
