CymitQuimica logo

CAS 24157-02-6

:

4-bromo-1,1-dimethoxybutane

Description:
4-Bromo-1,1-dimethoxybutane is an organic compound characterized by its structure, which includes a butane backbone with a bromine atom and two methoxy groups attached. The presence of the bromine atom introduces notable reactivity, making it a potential candidate for nucleophilic substitution reactions. The methoxy groups contribute to the compound's polarity and can influence its solubility in various solvents, typically enhancing solubility in polar organic solvents. This compound is likely to be a colorless to pale yellow liquid at room temperature, exhibiting a characteristic odor. Its molecular structure suggests that it may participate in various chemical reactions, including those typical of alkyl halides, such as elimination and substitution reactions. Additionally, the presence of the methoxy groups may allow for further functionalization, making it useful in synthetic organic chemistry. Safety data should be consulted, as halogenated compounds can pose health risks, and appropriate handling and storage conditions are essential.
Formula:C6H13BrO2
InChI:InChI=1/C6H13BrO2/c1-8-6(9-2)4-3-5-7/h6H,3-5H2,1-2H3
SMILES:COC(CCCBr)OC
Synonyms:
  • Butane, 4-Bromo-1,1-Dimethoxy-
  • 4-Bromobutyraldehyded Dimethyl Acetal
  • 4-Bromo-1,1-dimethoxybutane
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.