CymitQuimica logo

CAS 24158-88-1

:

(2S,5R)-6,6-Dibromo-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid

Description:
The chemical substance known as (2S,5R)-6,6-Dibromo-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid, with the CAS number 24158-88-1, is a bicyclic compound characterized by a unique thia-azabicyclo structure. This compound features a carboxylic acid functional group, which contributes to its acidity and potential reactivity. The presence of dibromo substituents indicates that it has two bromine atoms attached to the bicyclic framework, which can influence its chemical properties, such as reactivity and stability. The dimethyl groups provide additional steric bulk, affecting the compound's spatial configuration and interactions with other molecules. The stereochemistry, denoted by the (2S,5R) notation, indicates specific spatial arrangements of atoms, which can be crucial for biological activity and interactions. Overall, this compound's unique structure and functional groups suggest potential applications in medicinal chemistry or as a synthetic intermediate in organic synthesis. However, detailed studies would be necessary to fully understand its properties and potential uses.
Formula:C8H9Br2NO3S
InChI:InChI=1S/C8H9Br2NO3S/c1-7(2)3(4(12)13)11-5(14)8(9,10)6(11)15-7/h3,6H,1-2H3,(H,12,13)/t3-,6+/m0/s1
InChI key:InChIKey=YLGIIVBDSLVWDR-BBIVZNJYSA-N
SMILES:C(O)(=O)[C@@H]1N2[C@@](C(Br)(Br)C2=O)(SC1(C)C)[H]
Synonyms:
  • (2S,5R)-6,6-dibromo-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid
  • 4-Thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid, 6,6-dibromo-3,3-dimethyl-7-oxo-, (2S,5R)-
  • 4-Thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid, 6,6-dibromo-3,3-dimethyl-7-oxo-, (2S-cis)-
  • 6,6-Dibromopenicillanic acid
  • (2S-cis)-6,6-Dibromo-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo(3.2.0)heptane-2-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.