CAS 24160-14-3

3-(3,4-dimethoxyphenyl)-7-hydroxy-4H-chromen-4-one

Description:

3-(3,4-Dimethoxyphenyl)-7-hydroxy-4H-chromen-4-one, also known by its CAS number 24160-14-3, is a flavonoid compound characterized by its chromone backbone, which is a fused benzopyran structure. This compound features a hydroxyl group at the 7-position and a 3-(3,4-dimethoxyphenyl) substituent, contributing to its potential biological activity. Flavonoids are known for their antioxidant properties, and this particular compound may exhibit various pharmacological effects, including anti-inflammatory and anticancer activities, although specific studies would be necessary to confirm these effects. The presence of methoxy groups enhances its lipophilicity, potentially influencing its bioavailability and interaction with biological systems. Additionally, the compound's structural features suggest it may participate in various chemical reactions typical of flavonoids, such as oxidation and glycosylation. Overall, 3-(3,4-dimethoxyphenyl)-7-hydroxy-4H-chromen-4-one represents a class of compounds with significant interest in medicinal chemistry and natural product research.

Formula: C₁₇H₁₄O₅

InChI: InChI=1/C17H14O5/c1-20-14-6-3-10(7-16(14)21-2)13-9-22-15-8-11(18)4-5-12(15)17(13)19/h3-9,18H,1-2H3

SMILES: COc1ccc(cc1OC)c1coc2cc(ccc2c1=O)O

Synonyms:

• 4H-1-benzopyran-4-one, 3-(3,4-dimethoxyphenyl)-7-hydroxy-
• 3-(3,4-Dimethoxyphenyl)-7-hydroxy-4H-chromen-4-one

Astragalus Metabolite 8 (Cladrin)

CAS: 24160-14-3

Formula: C₁₇H₁₄O₅

Molecular weight: 298.29

Ref: 4Z-A-317008

3',4'-Dimethoxy-7-hydroxyisoflavone

CAS: 24160-14-3

3',4'-Dimethoxy-7-hydroxyisoflavone is a naturally occurring isoflavone, a type of flavonoid, which is typically derived from various plant sources. Isoflavones are known for their presence in soy and other legumes, but this particular compound is distinguished by its specific chemical structure, characterized by two methoxy groups and a hydroxyl group that contribute to its unique biological activity.

Formula: C₁₇H₁₄O₅

Purity: Min. 93 Area-%

Color and Shape: Yellow Powder

Molecular weight: 298.29 g/mol

Ref: 3D-FD65412

3-(3,4-Dimethoxyphenyl)-7-hydroxy-4H-chromen-4-one

Controlled Product

CAS: 24160-14-3

Formula: C₁₇H₁₄O₅

Color and Shape: Neat

Molecular weight: 298.29

Ref: TR-B428265