CAS 24164-06-5
:methyl N-(tert-butoxycarbonyl)-N-methylvalinate
Description:
Methyl N-(tert-butoxycarbonyl)-N-methylvalinate, with the CAS number 24164-06-5, is an organic compound that belongs to the class of amino acid derivatives. It features a methyl ester functional group, which contributes to its solubility in organic solvents. The tert-butoxycarbonyl (Boc) group serves as a protective group for the amine, making it useful in peptide synthesis and other organic reactions. This compound typically exhibits moderate stability under standard conditions but may be sensitive to strong acids or bases, which can lead to the cleavage of the Boc group. Its molecular structure includes a branched alkyl chain, which can influence its physical properties, such as boiling point and melting point. Methyl N-(tert-butoxycarbonyl)-N-methylvalinate is often utilized in pharmaceutical and biochemical applications, particularly in the synthesis of more complex molecules. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices are followed.
Formula:C12H23NO4
InChI:InChI=1/C12H23NO4/c1-8(2)9(10(14)16-7)13(6)11(15)17-12(3,4)5/h8-9H,1-7H3
SMILES:CC(C)C(C(=O)OC)N(C)C(=O)OC(C)(C)C
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Methyl (S)-2-((tert-butoxycarbonyl)(methyl)amino)-3-methylbutanoate
CAS:Methyl (S)-2-((tert-butoxycarbonyl)(methyl)amino)-3-methylbutanoatePurity:99%Molecular weight:245.32g/mol(S)-METHYL 2-((TERT-BUTOXYCARBONYL)(METHYL)AMINO)-3-METHYLBUTANOATE
CAS:Purity:97%Molecular weight:245.3190002NSC 135130
CAS:NSC 135130 is a synthetic compound that serves as an antioxidant and anti-inflammatory agent. It is derived through chemical synthesis, a process involving the combination of various elements and compounds to produce a novel substance with specific desired properties. The mode of action of NSC 135130 primarily involves the scavenging of free radicals and modulation of inflammatory pathways, thus helping to mitigate oxidative stress and inflammation at the cellular level.
Formula:C12H23NO4Purity:Min. 95%Molecular weight:245.32 g/molNSC 135130
CAS:NSC 135130 (compound 11a), a BOC-protected ADC linker, facilitates the synthesis of drug conjugates by attaching to tubulin-targeting inhibitors [1].Formula:C12H23NO4Color and Shape:SolidMolecular weight:245.319




