CAS 24169-72-0

2-(1H-imidazol-1-yl)-1-phenylethanamine

Description:

2-(1H-imidazol-1-yl)-1-phenylethanamine, also known as phenethylamine derivative, is a chemical compound characterized by its imidazole and phenyl functional groups. It typically appears as a solid or crystalline substance and is soluble in polar solvents like water and alcohols due to the presence of the amine and imidazole moieties. This compound exhibits basic properties, as the amine group can accept protons, making it a potential ligand in coordination chemistry. Its structure suggests potential biological activity, as many imidazole-containing compounds are known for their roles in pharmacology, particularly in the development of drugs targeting various receptors. The presence of both the imidazole and phenyl groups may contribute to its ability to interact with biological systems, potentially influencing neurotransmitter pathways. Additionally, the compound may undergo various chemical reactions, including alkylation and acylation, which can be utilized in synthetic organic chemistry. Overall, 2-(1H-imidazol-1-yl)-1-phenylethanamine is of interest in both academic research and pharmaceutical applications.

Formula: C₁₁H₁₃N₃

InChI: InChI=1/C11H13N3/c12-11(8-14-7-6-13-9-14)10-4-2-1-3-5-10/h1-7,9,11H,8,12H2

SMILES: c1ccc(cc1)C(Cn1ccnc1)N

Synonyms:

• 1H-imidazole-1-ethanamine, alpha-phenyl-

[2-(1H-imidazol-1-yl)-1-phenylethyl]amine dihydrochloride hydrate

CAS: 24169-72-0

Formula: C₁₁H₁₇Cl₂N₃O

Purity: 95.0%

Molecular weight: 278.18

Ref: 10-F358660