CAS 241800-98-6: 5-cyclopropyl-N-(diaminomethylidene)-1-quinolin-5-yl-1H-pyrazole-4-carboxamide
Description:5-Cyclopropyl-N-(diaminomethylidene)-1-quinolin-5-yl-1H-pyrazole-4-carboxamide is a chemical compound characterized by its complex structure, which includes a quinoline moiety, a pyrazole ring, and a cyclopropyl group. This compound features a carboxamide functional group, which contributes to its potential biological activity. The presence of the diaminomethylidene substituent suggests that it may participate in various chemical reactions, possibly influencing its reactivity and interaction with biological targets. The cyclopropyl group can impart unique steric and electronic properties, potentially affecting the compound's pharmacokinetics and pharmacodynamics. As a member of the pyrazole and quinoline families, this compound may exhibit interesting medicinal properties, including anti-inflammatory, antimicrobial, or anticancer activities. Its specific applications and efficacy would depend on further research and characterization, including studies on its solubility, stability, and interaction with biological systems. Overall, this compound represents a promising area of study in medicinal chemistry and drug development.
Formula:C17H16N6O
InChI:InChI=1/C17H16N6O/c18-17(19)22-16(24)12-9-21-23(15(12)10-6-7-10)14-5-1-4-13-11(14)3-2-8-20-13/h1-5,8-10H,6-7H2,(H4,18,19,22,24)
- Synonyms:
- (1-(quinolin-5-yl)-5-cyclopropyl-1H-pyrazole-4-carbonyl)guanidine
- 1H-pyrazole-4-carboxamide, N-(aminoiminomethyl)-5-cyclopropyl-1-(5-quinolinyl)-
- N-carbamimidoyl-5-cyclopropyl-1-(quinolin-5-yl)-1H-pyrazole-4-carboxamide