CAS 241820-91-7

2-oxa-7-azaspiro[3.5]nonane

Description:

2-Oxa-7-azaspiro[3.5]nonane is a bicyclic organic compound characterized by its unique spiro structure, which consists of a nitrogen atom and an oxygen atom incorporated into its framework. This compound features a spirocyclic arrangement, where two rings share a single atom, contributing to its distinctive three-dimensional shape. The presence of the nitrogen atom introduces basicity and potential for hydrogen bonding, while the oxygen atom can participate in various chemical interactions, enhancing its reactivity. Typically, compounds of this nature may exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. The molecular structure suggests potential applications in drug development, particularly in the design of novel therapeutics. Additionally, the compound's stability and solubility characteristics can vary based on the substituents attached to the spiro framework, influencing its behavior in biological systems. Overall, 2-oxa-7-azaspiro[3.5]nonane represents a fascinating example of spirocyclic chemistry with potential implications in various fields, including organic synthesis and pharmaceutical research.

Formula: C₇H₁₃NO

InChI: InChI=1/C7H13NO/c1-3-8-4-2-7(1)5-9-6-7/h8H,1-6H2

SMILES: C1CNCCC21COC2

Synonyms:

• 2-Oxa-7-azaspiro[3.5]nonan
• 2-Oxa-7-Azaspiro[3.5]nonane

2-Oxa-7-azaspiro[3.5]nonane

CAS: 241820-91-7

2-Oxa-7-azaspiro[3.5]nonane

Purity: 98%

Molecular weight: 127.18g/mol

Ref: 54-OR17715

2-Oxa-7-azaspiro[3.5]nonane

CAS: 241820-91-7

Formula: C₇H₁₃NO

Purity: 95%

Color and Shape: Solid

Molecular weight: 127.187

Ref: 10-F219747

2-Oxa-7-azaspiro[3.5]nonane

Controlled Product

CAS: 241820-91-7

Formula: C₇H₁₃NO

Color and Shape: Neat

Molecular weight: 127.184

Ref: TR-O231325