
CAS 241825-88-7
:7-(4-bromobenzoyl)-1H-Indole-2,3-dione
Description:
7-(4-Bromobenzoyl)-1H-Indole-2,3-dione, with the CAS number 241825-88-7, is a synthetic organic compound that belongs to the class of indole derivatives. This compound features a bromobenzoyl group attached to the indole structure, which contributes to its unique chemical properties. It typically exhibits a solid state at room temperature and is characterized by its distinct color, which can vary depending on the specific formulation and purity. The presence of the bromine atom enhances its reactivity and can influence its biological activity, making it of interest in medicinal chemistry. The indole moiety is known for its role in various biological systems and can participate in a range of chemical reactions, including electrophilic substitutions. This compound may also exhibit fluorescence properties, making it useful in various applications, including as a probe in biochemical assays. Its solubility can vary in different solvents, which is an important consideration for its application in research and industry. Overall, 7-(4-bromobenzoyl)-1H-Indole-2,3-dione is a versatile compound with potential applications in pharmaceuticals and materials science.
Formula:C15H8BrNO3
InChI:InChI=1S/C15H8BrNO3/c16-9-6-4-8(5-7-9)13(18)10-2-1-3-11-12(10)17-15(20)14(11)19/h1-7H,(H,17,19,20)
InChI key:OKYHDBOEDYARAM-UHFFFAOYSA-N
SMILES:C1=CC2=C(C(=C1)C(=O)C3=CC=C(C=C3)Br)NC(=O)C2=O
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Bromobenzoylindoline Dione
CAS:Lactams, nesoiFormula:C15H8BrNO3Color and Shape:Yellow Orange SolidMolecular weight:328.968767-(4-Bromobenzoyl)indoline-2,3-dione
CAS:Formula:C15H8BrNO3Purity:95%Color and Shape:SolidMolecular weight:330.13297-(4-Bromobenzoyl)indoline-2,3-dione
CAS:7-(4-Bromobenzoyl)indoline-2,3-dioneFormula:C15H8BrNO3Purity:95%Molecular weight:330.13AHR 11652
CAS:Controlled ProductApplications AHR 11652 is a metabolite of Bromfenac sodium (B678550).
References Walsh, D.A., et al.: J. Med. Chem., 25, 446 (1982),Formula:C15H8BrNO3Color and Shape:NeatMolecular weight:330.13AHR 11652
CAS:AHR 11652 is a synthetic chemical compound designed as a research tool, which is derived from laboratory synthesis processes. With its specific mode of action targeting distinct cellular pathways, AHR 11652 is utilized to explore receptor-ligand interactions and to elucidate intracellular signaling mechanisms in various biological systems. Scientists leverage this compound to gain insight into the modulation of physiological responses, such as gene expression and cellular growth.Formula:C15H8BrNO3Purity:Min. 95%Molecular weight:330.13 g/mol







