CAS 24186-38-7

3-(4-Methylphenyl)-2-propenoyl azide

Description:

3-(4-Methylphenyl)-2-propenoyl azide, with the CAS number 24186-38-7, is an organic compound characterized by the presence of an azide functional group (-N3) attached to a propenoyl moiety. This compound features a 4-methylphenyl group, which contributes to its aromatic characteristics and influences its reactivity and stability. The presence of the azide group suggests potential for undergoing various chemical reactions, including cycloaddition and nucleophilic substitutions, making it of interest in synthetic organic chemistry and materials science. The compound is likely to be sensitive to heat and shock due to the azide functionality, which is known for its explosive properties under certain conditions. Additionally, its structure may impart specific optical or electronic properties, making it a candidate for applications in photochemistry or as a precursor in the synthesis of more complex molecules. As with many azides, handling precautions are necessary to ensure safety during its use and storage.

Formula: C₁₀H₉N₃O

InChI: InChI=1S/C10H9N3O/c1-8-2-4-9(5-3-8)6-7-10(14)12-13-11/h2-7H,1H3

InChI key: InChIKey=IFVSVRKWJLKNIT-UHFFFAOYSA-N

SMILES: C(=CC(N=[N+]=[N-])=O)C1=CC=C(C)C=C1

Synonyms:

• 2-Propenoyl azide, 3-(4-methylphenyl)-
• Cinnamoyl azide, p-methyl-
• 3-(4-Methylphenyl)-2-propenoyl azide

p-Methyl-cinnamoyl Azide

Controlled Product

CAS: 24186-38-7

Applications p-Methyl-cinnamoyl Azide (cas# 24186-38-7) is a compound useful in organic synthesis.

Formula: C₁₀H₉N₃O

Color and Shape: White

Molecular weight: 187.2

Ref: TR-M294515