CAS 24186-59-2

(1E)-[(5-nitrofuran-2-yl)methylidene]hydrazine

Description:

(1E)-[(5-nitrofuran-2-yl)methylidene]hydrazine, with the CAS number 24186-59-2, is a chemical compound characterized by its unique structure, which includes a hydrazine moiety and a nitrofuran group. This compound typically exhibits properties associated with both hydrazines and nitro compounds, such as potential reactivity and biological activity. The presence of the nitrofuran ring suggests that it may possess antimicrobial or antitumor properties, as many nitrofuran derivatives are known for their pharmacological applications. The hydrazine part of the molecule can participate in various chemical reactions, including condensation and oxidation, making it a versatile intermediate in organic synthesis. Additionally, the compound may display specific solubility characteristics depending on the solvent used, and its stability can be influenced by environmental factors such as pH and temperature. Overall, (1E)-[(5-nitrofuran-2-yl)methylidene]hydrazine is of interest in both synthetic chemistry and medicinal chemistry due to its potential applications and reactivity.

Formula: C₅H₅N₃O₃

InChI: InChI=1/C5H5N3O3/c6-7-3-4-1-2-5(11-4)8(9)10/h1-3H,6H2/b7-3+

Synonyms:

• 2-Furaldehyde, 5-nitro-, hydrazone
• 2-Furancarboxaldehyde, 5-Nitro-, Hydrazone
• 2-Furancarboxaldehyde, 5-nitro-, hydrazone (9CI)

5-Nitrofurfural Hydrazone

CAS: 24186-59-2

Color and Shape: Neat

Ref: 86-MM0444.02