CAS 24192-64-1

1,4-bis(3,4,5-trimethoxyphenyl)tetrahydro-1H,3H-furo[3,4-c]furan

Description:

1,4-bis(3,4,5-trimethoxyphenyl)tetrahydro-1H,3H-furo[3,4-c]furan, with the CAS number 24192-64-1, is a complex organic compound characterized by its unique molecular structure, which includes a tetrahydrofuran ring fused with a furan moiety and two trimethoxyphenyl groups. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity due to its phenolic components. The presence of multiple methoxy groups enhances its lipophilicity and may influence its reactivity and interaction with biological systems. Additionally, the compound may display interesting optical properties, making it a candidate for studies in materials science and medicinal chemistry. Its synthesis often involves multi-step organic reactions, highlighting its complexity. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards. Overall, this compound represents a fascinating area of study within organic chemistry, particularly in the context of drug development and functional materials.

Formula: C₂₄H₃₀O₈

InChI: InChI=1/C24H30O8/c1-25-17-7-13(8-18(26-2)23(17)29-5)21-15-11-32-22(16(15)12-31-21)14-9-19(27-3)24(30-6)20(10-14)28-4/h7-10,15-16,21-22H,11-12H2,1-6H3

SMILES: COc1cc(cc(c1OC)OC)C1C2COC(c3cc(c(c(c3)OC)OC)OC)C2CO1

Epiyangambin

CAS: 24192-64-1

Epiyangambin is a phytotoxic lignan, it shows inhibition of seed germination of Agrostis stolonifera cv.

Formula: C₂₄H₃₀O₈

Purity: 98%

Color and Shape: Solid

Molecular weight: 446.49

Ref: TM-TN3979

Epiyangambin

CAS: 24192-64-1

Formula: C₂₄H₃₀O₈

Purity: 95%~99%

Molecular weight: 446.496

Ref: BP-SBP04121

1,4-Bis(3,4,5-trimethoxyphenyl)tetrahydro-1H,3H-furo[3,4-c]furan

CAS: 24192-64-1

1,4-Bis(3,4,5-trimethoxyphenyl)tetrahydro-1H,3H-furo[3,4-c]furan is a synthetic compound, which is derived from chemical synthesis, involving the assembly of a tetrahydrofuran-fused furan ring system with trimethoxyphenyl substituents. This compound is designed through intricate organic synthesis techniques involving multiple steps and precise conditions to achieve its complex structure.

Formula: C₂₄H₃₀O₈

Purity: Min. 95%

Molecular weight: 446.5 g/mol

Ref: 3D-ZAA19264