CAS 24198-97-8
:rel-(2R,3R)-2-(3,4-Dihydroxyphenyl)-2,3-dihydro-3,5,7-trihydroxy-4H-1-benzopyran-4-one
Description:
The chemical substance known as rel-(2R,3R)-2-(3,4-Dihydroxyphenyl)-2,3-dihydro-3,5,7-trihydroxy-4H-1-benzopyran-4-one, with the CAS number 24198-97-8, is a flavonoid compound characterized by its complex polyphenolic structure. This compound features multiple hydroxyl groups, which contribute to its potential antioxidant properties, making it of interest in various biological and pharmacological studies. The presence of the benzopyran moiety indicates that it belongs to the flavonoid class, which is known for its diverse biological activities, including anti-inflammatory, anti-cancer, and neuroprotective effects. The stereochemistry of the molecule, indicated by the rel-(2R,3R) configuration, suggests specific spatial arrangements that can influence its biological interactions and efficacy. Additionally, the dihydroxyphenyl group enhances its reactivity and potential interactions with biological targets. Overall, this compound's unique structure and functional groups position it as a candidate for further research in medicinal chemistry and natural product studies.
Formula:C15H12O7
InChI:InChI=1/C15H12O7/c16-7-4-10(19)12-11(5-7)22-15(14(21)13(12)20)6-1-2-8(17)9(18)3-6/h1-5,14-19,21H/t14-,15+/s2
InChI key:InChIKey=CXQWRCVTCMQVQX-PVRQQBJHNA-N
SMILES:O=C1C=2C(O[C@@H]([C@H]1O)C3=CC(O)=C(O)C=C3)=CC(O)=CC2O
Synonyms:- (?à)-Dihydroquercetin
- (?à)-Taxifolin
- (±)-Dihydroquercetin
- (±)-Taxifolin
- 4H-1-Benzopyran-4-one, 2-(3,4-dihydroxyphenyl)-2,3-dihydro-3,5,7-trihydroxy-, trans-(±)-
- 4H-1-Benzopyran-4-one,2-(3,4-dihydroxyphenyl)-2,3-dihydro-3,5,7-trihydroxy-, trans-(?à)- (8CI)
- rel-(2R,3R)-2-(3,4-Dihydroxyphenyl)-2,3-dihydro-3,5,7-trihydroxy-4H-1-benzopyran-4-one
- 4H-1-Benzopyran-4-one, 2-(3,4-dihydroxyphenyl)-2,3-dihydro-3,5,7-trihydroxy-, (2R,3R)-rel-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
rel-(2R,3R)-2-(3,4-Dihydroxyphenyl)-2,3-dihydro-3,5,7-trihydroxy-4H-1-benzopyran-4-one
CAS:Formula:C15H12O7Purity:98%Color and Shape:SolidMolecular weight:304.2516(+/-)-Taxifolin hydrate
CAS:Formula:C15H12O7·xH2OPurity:≥ 95.0%Color and Shape:White, off-white or pale yellow powderMolecular weight:304.25 (anhydrous)(±)-Taxifolin
CAS:(±)-Taxifolin ((±)-Dihydroquercetin) is the racemate of Taxifolin, a flavonoid commonly found in onion, silymarin, French maritime pine bark, and Douglas firFormula:C15H12O7Purity:97.23%Color and Shape:SolidMolecular weight:304.25(+/-)-trans Taxifolin
CAS:Controlled ProductFormula:C15H12O7Color and Shape:NeatMolecular weight:304.25(+/-)-Taxifolin
CAS:(+/-)-Taxifolin is a flavonoid compound, which is a type of polyphenolic antioxidant. It is derived primarily from natural sources such as the Siberian larch tree (Larix sibirica), among other plant species. Its mode of action involves the scavenging of free radicals and inhibition of oxidative stress pathways, contributing to reduced cellular damage caused by reactive oxygen species (ROS). Furthermore, taxifolin modulates the activity of various enzymes and receptors involved in inflammatory pathways, thereby exerting anti-inflammatory effects.Formula:C15H12O7Purity:Min. 95%Color and Shape:PowderMolecular weight:304.25 g/mol(+/-)-Taxifolin - Bio-X ™
CAS:This product is part of our Bio-X ™ Range. These products are aimed at life science researchers who need high quality ready-to-use products for assay development, screening or other R&D work. With a solubility datasheet and convenient vials, all of our Bio-X ™ products are in stock across our global warehouses for rapid delivery and ease of use.Formula:C15H12O7Purity:Min. 95%Color and Shape:PowderMolecular weight:304.25 g/mol(+/-)-trans Taxifolin-d3
CAS:Controlled ProductFormula:C15D3H9O7Color and Shape:NeatMolecular weight:307.27







