CAS 24199-46-0
:6-Methyl-5-octen-2-one
Description:
6-Methyl-5-octen-2-one is an organic compound classified as a ketone, characterized by its aliphatic structure featuring a double bond and a methyl group. It has a molecular formula that reflects its carbon and hydrogen content, contributing to its unique properties. This compound typically exhibits a pleasant, fruity odor, making it of interest in the flavor and fragrance industries. Its structure includes a long carbon chain with a double bond, which influences its reactivity and physical properties, such as boiling point and solubility. 6-Methyl-5-octen-2-one is often synthesized through various organic reactions, including alkylation and oxidation processes. It is important in research and industrial applications, particularly in the synthesis of other organic compounds. Safety data indicates that, like many ketones, it should be handled with care, as it may pose health risks if inhaled or ingested. Overall, 6-Methyl-5-octen-2-one is a versatile compound with applications in both synthetic chemistry and the production of consumer products.
Formula:C9H16O
InChI:InChI=1S/C9H16O/c1-4-8(2)6-5-7-9(3)10/h6H,4-5,7H2,1-3H3
InChI key:InChIKey=SAXWRVSDVXCTEL-UHFFFAOYSA-N
SMILES:C(=CCCC(C)=O)(CC)C
Synonyms:- 3-Methyl-3-octen-7-one
- 6-Methyl-5-octene-2-one
- 5-Octen-2-one, 6-methyl-
- 6-Methyl-5-octen-2-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

