CAS 24206-39-1
:1,2,3,4-tetrahydroquinolin-4-ol
Description:
1,2,3,4-Tetrahydroquinolin-4-ol is a bicyclic organic compound characterized by a fused ring structure that includes a quinoline moiety. It features a saturated tetrahydro framework with a hydroxyl (-OH) group at the 4-position of the quinoline ring. This compound is typically a colorless to pale yellow solid and is soluble in polar solvents such as water and alcohols, owing to the presence of the hydroxyl group. Its molecular structure contributes to its potential biological activity, making it of interest in medicinal chemistry for its possible applications in drug development. The compound may exhibit various pharmacological properties, including antimicrobial and antioxidant activities. Additionally, it can serve as an intermediate in organic synthesis, particularly in the preparation of more complex nitrogen-containing heterocycles. As with many organic compounds, handling should be done with care, considering safety data and potential hazards associated with its use.
Formula:C9H11NO
InChI:InChI=1/C9H11NO/c11-9-5-6-10-8-4-2-1-3-7(8)9/h1-4,9-11H,5-6H2
SMILES:c1ccc2c(c1)C(CCN2)O
Synonyms:- 4-Quinolinol, 1,2,3,4-Tetrahydro-
- 1,2,3,4-Tetrahydroquinolin-4-ol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1,2,3,4-Tetrahydroquinolin-4-ol
CAS:Formula:C9H11NOPurity:98%Color and Shape:SolidMolecular weight:149.18971,2,3,4-Tetrahydroquinolin-4-ol
CAS:1,2,3,4-Tetrahydroquinolin-4-olPurity:95%Molecular weight:149.19g/mol1,2,3,4-Tetrahydroquinolin-4-ol
CAS:Formula:C9H11NOPurity:95%Color and Shape:SolidMolecular weight:149.1931,2,3,4-Tetrahydroquinolin-4-ol
CAS:1,2,3,4-tetrahydroquinolin-4-ol is a versatile compound with various applications in the pharmaceutical and chemical industries. It serves as a building block for the synthesis of numerous compounds such as hydrazines, aldehydes, tranilast, vemurafenib, phosphoric derivatives, dorzolamide hydrochloride, aluminum complexes, duloxetine, pregnenolone derivatives, stachyose, ginsenosides, dopamine derivatives, carotenoids, cilostazol and many more. With its wide range of uses and potential for creating new molecules through chemical reactions and modifications, 1,2,3,4-tetrahydroquinolin-4-ol is an essential component for researchers and professionals working in the field of research chemicals.
Formula:C9H11NOPurity:Min. 95%Molecular weight:149.19 g/mol



