CAS 24211-30-1
:(-)-Farrerol
Description:
(-)-Farrerol, with the CAS number 24211-30-1, is a naturally occurring flavonoid compound primarily found in various plant species. It is characterized by its chiral structure, which contributes to its specific biological activities. This compound typically exhibits antioxidant properties, making it of interest in pharmacological and nutraceutical research. (-)-Farrerol is known for its potential anti-inflammatory and anti-cancer effects, as well as its ability to modulate certain cellular pathways. In terms of solubility, it is generally soluble in organic solvents but may have limited solubility in water. The compound's molecular structure includes multiple hydroxyl groups, which enhance its reactivity and interaction with biological systems. Additionally, (-)-Farrerol's stereochemistry plays a crucial role in its biological activity, as different enantiomers can exhibit varying effects. Overall, (-)-Farrerol is a compound of significant interest in the fields of natural product chemistry and medicinal research due to its diverse potential applications.
Formula:C17H16O5
InChI:InChI=1S/C17H16O5/c1-8-15(20)9(2)17-14(16(8)21)12(19)7-13(22-17)10-3-5-11(18)6-4-10/h3-6,13,18,20-21H,7H2,1-2H3/t13-/m0/s1
InChI key:InChIKey=DYHOLQACRGJEHX-ZDUSSCGKSA-N
SMILES:CC1=C2C(C(=O)C[C@H](O2)C3=CC=C(O)C=C3)=C(O)C(C)=C1O
Synonyms:- (2S)-2,3-Dihydro-5,7-dihydroxy-2-(4-hydroxyphenyl)-6,8-dimethyl-4H-1-benzopyran-4-one
- (2S)-5,7-Dihydroxy-2-(4-hydroxyphenyl)-6,8-dimethyl-2,3-dihydrochromen-4-one
- (2S)-5,7-dihydroxy-2-(4-hydroxyphenyl)-6,8-dimethyl-2,3-dihydro-4H-chromen-4-one
- (S)-2,3-dihydro-5,7-dihydroxy-2-(4-hydroxyphenyl)-6,8-dimethyl-4-benzopyrone
- 4H-1-Benzopyran-4-one, 2,3-dihydro-5,7-dihydroxy-2-(4-hydroxyphenyl)-6,8-dimethyl-, (2S)-
- 4H-1-Benzopyran-4-one, 2,3-dihydro-5,7-dihydroxy-2-(4-hydroxyphenyl)-6,8-dimethyl-, (S)-
- 5,7-dihydroxy-2-(4-hydroxyphenyl)-6,8-dimethyl-2,3-dihydro-4H-chromen-4-one
- 6,8-Dimethyl-4',5,7-Trihydroxyflavanone
- Flavanone, 4′,5,7-trihydroxy-6,8-dimethyl-, (-)-
- Farrerol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
6,8-DIMETHYL-4',5,7-TRIHYDROXYFLAVANONE
CAS:Formula:C17H16O5Purity:98%Color and Shape:SolidMolecular weight:300.3059(S)-5,7-Dihydroxy-2-(4-Hydroxyphenyl)-6,8-Dimethylchroman-4-One
CAS:(S)-5,7-Dihydroxy-2-(4-Hydroxyphenyl)-6,8-Dimethylchroman-4-OnePurity:98%Molecular weight:300.31g/molFarrerol
CAS:Farrerol has antioxidative, anti-bacterial, anti-inflammatory, antiangiogenic activities, it is a potential candidate for the intervention of endothelial-injury-associated cardiovascular diseases. Farrerol inactivates KEAP-1 or activates the Akt, p38 and ERK to facilitate the release of Nrf2 from Keap1 and subsequent reduces the intracellular production of reactive oxygen species via the induction of HO-1 expression. Farrerol can inhibit angiogenesis through down regulation of Akt/mTOR, Erk and Jak2/Stat3 signal pathway, and can inhibit IL-1β-induced inflammatory responses in osteoarthritis chondrocytes by blocking PI3K/Akt/NF-κB signaling pathway.Formula:C17H16O5Purity:95%~99%Molecular weight:300.31Farrerol
CAS:Farrerol shows antioxidative effects, modulates genes, fights S. aureus in cows, protects cells, and may prevent heart disease.Formula:C17H16O5Purity:99.70% - 99.96%Color and Shape:SolidMolecular weight:300.31Ref: TM-T6S0525
2mg40.00€5mg56.00€10mg80.00€25mg114.00€50mg167.00€100mg240.00€200mg355.00€1mL*10mM (DMSO)67.00€Cyrtopterinetin
CAS:Cyrtopterinetin is a naturally occurring flavonoid compound, which is derived from specific plant sources such as Cyrtomium species in Pteridaceae. This compound exerts its biological effects primarily through the modulation of various signaling pathways. It affects key molecular targets involved in the regulation of cell proliferation, apoptosis, and inflammation. The ability of cyrtopterinetin to influence these pathways is attributed to its capacity to bind with cellular proteins and alter gene expression.Formula:C17H16O5Purity:Min. 98 Area-%Molecular weight:300.31 g/mol5,7-Dihydroxy-2-(4-hydroxyphenyl)-6,8-dimethylchroman-4-one
CAS:Formula:C17H16O5Purity:≥98%(HPLC)Molecular weight:300.31






