
CAS 24218-00-6
:Ribulose 1,5-bisphosphate
Description:
Ribulose 1,5-bisphosphate (RuBP) is a crucial organic compound in the process of photosynthesis, specifically in the Calvin cycle, where it acts as a substrate for the enzyme ribulose-1,5-bisphosphate carboxylase/oxygenase (RuBisCO). This five-carbon sugar phosphate is characterized by its two phosphate groups attached to the first and fifth carbon atoms. RuBP plays a vital role in carbon fixation, enabling the conversion of atmospheric carbon dioxide into organic molecules. It is a colorless, water-soluble compound that is typically found in the chloroplasts of plant cells. The structure of RuBP allows it to participate in various biochemical reactions, making it essential for plant metabolism and growth. Additionally, its stability and reactivity are influenced by environmental factors such as pH and temperature, which can affect the efficiency of photosynthesis. Overall, ribulose 1,5-bisphosphate is integral to the biosphere, supporting life by facilitating the conversion of inorganic carbon into organic forms.
Formula:C5H12O11P2
InChI:InChI=1S/C5H12O11P2/c6-3(1-15-17(9,10)11)5(8)4(7)2-16-18(12,13)14/h3,5-6,8H,1-2H2,(H2,9,10,11)(H2,12,13,14)/t3-,5-/m1/s1
InChI key:InChIKey=YAHZABJORDUQGO-NQXXGFSBSA-N
SMILES:[C@@H]([C@@H](COP(=O)(O)O)O)(C(COP(=O)(O)O)=O)O
Synonyms:- D-Ribulose 1,5-bisphosphate
- D-erythro-Pentulose, 1,5-bis(dihydrogen phosphate)
- D-erythro-2-Pentulose, 1,5-bis(dihydrogen phosphate)
- Ribulose 1,5-bisphosphate
- D-Ribulose 1,5-diphosphate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
D-Ribulose 1,5-bisphosphate sodium hydrate
CAS:<p>D-ribulose 1,5-bisphosphate sodium hydrate (DRBP) is a naturally occurring sugar that is found in plants. It is synthesized by the action of ribulose bisphosphate carboxylase on ribulose 1,5-bisphosphate, with ATP as a cofactor. DRBP has been shown to be an important intermediate in many biochemical pathways and enzymes. DRBP has been shown to inhibit HIV replication in vitro by binding to the enzyme reverse transcriptase and blocking its activity. As an inhibitor of HIV replication, DRBP is activated by a number of factors including p-nitrophenyl phosphate (pNPP), and the presence of hydrogen bond donors such as ATP or NADP+. This chemical also inhibits protease activity and increases the transport rate for D-ribulose 1,5-bisphosphate.</p>Formula:C5H12O11P2•Nax•(H2O)yPurity:Min. 95%Color and Shape:PowderMolecular weight:310.09 g/mol
