CymitQuimica logo

CAS 24228-13-5

:

3-phenylpyridin-2(1H)-one

Description:
3-Phenylpyridin-2(1H)-one, with the CAS number 24228-13-5, is an organic compound characterized by its pyridine ring fused with a phenyl group and a ketone functional group. This compound typically exhibits a pale yellow to light brown solid appearance. It is known for its potential biological activities, including antimicrobial and anti-inflammatory properties, making it of interest in medicinal chemistry. The presence of the phenyl group enhances its lipophilicity, which can influence its interaction with biological targets. Additionally, the compound may participate in various chemical reactions due to the reactivity of the carbonyl group, allowing for further derivatization. Its solubility can vary depending on the solvent, often being more soluble in organic solvents than in water. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks if ingested or inhaled. Overall, 3-phenylpyridin-2(1H)-one is a versatile compound with applications in research and potential therapeutic uses.
Formula:C11H9NO
InChI:InChI=1/C11H9NO/c13-11-10(7-4-8-12-11)9-5-2-1-3-6-9/h1-8H,(H,12,13)
InChI key:FLYJEBSUJDZJDE-UHFFFAOYSA-N
SMILES:c1ccc(cc1)c1cccnc1O
Synonyms:
  • 2-Pyridinol, 3-Phenyl-
  • 3-Phenylpyridin-2-ol
Found 4 products.