CAS 2423-84-9
:Pyrazine-N,N'-dioxide
Description:
Pyrazine-N,N'-dioxide, with the CAS number 2423-84-9, is a heterocyclic organic compound characterized by a pyrazine ring that is substituted with two oxo groups at the nitrogen atoms. This compound typically appears as a white to off-white crystalline solid and is known for its relatively high stability under standard conditions. Pyrazine-N,N'-dioxide exhibits polar characteristics due to the presence of the nitrogen and oxygen functional groups, which can influence its solubility in various solvents, often making it soluble in polar solvents like water and alcohols. The compound is of interest in various fields, including medicinal chemistry and materials science, due to its potential biological activity and ability to form coordination complexes with metals. Additionally, its unique structure allows for various chemical modifications, which can enhance its properties for specific applications. Safety data indicates that, like many nitrogen-containing compounds, it should be handled with care, as it may pose health risks if ingested or inhaled.
Formula:C4H4N2O2
InChI:InChI=1/C4H4N2O2/c7-5-1-2-6(8)4-3-5/h1-4H
SMILES:c1cn(=O)ccn1=O
Synonyms:- Pyrazine, 1,4-dioxide
- 1-oxopyrazin-1-ium-4(1H)-olate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Pyrazine 1,4-Dioxide
CAS:Controlled Product<p>Applications Pyrazine 1,4-Dioxide (cas# 2423-84-9) is a compound useful in organic synthesis.<br> Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package<br></p>Formula:C4H4N2O2Color and Shape:NeatMolecular weight:112.09
