CAS 2424-92-2: Eicosanedioic acid
Description:Eicosanedioic acid, also known as icosanedioic acid, is a dicarboxylic acid with the molecular formula C20H38O4. It features a long hydrocarbon chain consisting of 20 carbon atoms, with two carboxylic acid functional groups (-COOH) located at each end of the chain. This structure contributes to its classification as a linear aliphatic dicarboxylic acid. Eicosanedioic acid is typically a white, waxy solid at room temperature and is insoluble in water but soluble in organic solvents. It has applications in various fields, including the production of polyesters, lubricants, and surfactants. The compound can also be used in the synthesis of other chemical derivatives. Its physical properties, such as melting point and boiling point, are influenced by the length of the carbon chain and the presence of functional groups. As with many dicarboxylic acids, eicosanedioic acid can participate in various chemical reactions, including esterification and amidation, making it a versatile compound in organic synthesis.
Formula:C20H38O4
InChI:InChI=1S/C20H38O4/c21-19(22)17-15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16-18-20(23)24/h1-18H2,(H,21,22)(H,23,24)
InChI key:InChIKey=JJOJFIHJIRWASH-UHFFFAOYSA-N
SMILES:O=C(O)CCCCCCCCCCCCCCCCCCC(=O)O
- Synonyms:
- 1,18-Octadecanedicarboxylic acid
- 1,20-Eicosanedioic acid
- C 20 fatty acid
- Eicosan-1,20-dioic acid
- Eicosanedioic acid
- Icosanedioate
- Icosanedioic Acid
- Octadecamethylenedicarboxylic acid
- Sl 20-90
- Sl 20-93
- See more synonyms
- Sl 20-99
