CAS 24240-05-9

5,7,8,15-Tetrahydro-6-methylbis[1,3]benzodioxolo[5,6-c:5′,6′-g]azecin-14(6H)-one

Description:

5,7,8,15-Tetrahydro-6-methylbis[1,3]benzodioxolo[5,6-c:5′,6′-g]azecin-14(6H)-one, with the CAS number 24240-05-9, is a complex organic compound characterized by its unique bicyclic structure that incorporates both benzodioxole and azecine moieties. This compound typically exhibits a range of chemical properties, including potential solubility in organic solvents, which may vary based on the specific functional groups present. Its molecular structure suggests that it may engage in various chemical reactions, including electrophilic substitutions and potential interactions with biological systems, making it of interest in medicinal chemistry and pharmacology. The presence of multiple rings and functional groups may contribute to its stability and reactivity, influencing its behavior in different chemical environments. Additionally, compounds of this nature often exhibit interesting spectroscopic properties, which can be analyzed using techniques such as NMR and mass spectrometry for structural elucidation. Overall, this compound represents a fascinating area of study within organic chemistry and its applications.

Formula: C₂₀H₁₉NO₅

InChI: InChI=1S/C20H19NO5/c1-21-3-2-12-5-17-20(26-11-23-17)8-15(12)16(22)4-13-6-18-19(25-10-24-18)7-14(13)9-21/h5-8H,2-4,9-11H2,1H3

InChI key: InChIKey=ZAALQOFZFANFTF-UHFFFAOYSA-N

SMILES: O=C1CC=2C(=CC3=C(C2)OCO3)CN(C)CCC=4C1=CC5=C(C4)OCO5

Synonyms:

• 5,7,8,15-Tetrahydro-6-methylbis[1,3]benzodioxolo[5,6-c:5′,6′-g]azecin-14(6H)-one
• Bis[1,3]benzodioxolo[5,6-c:5′,6′-g]azecin-14(6H)-one, 5,7,8,15-tetrahydro-6-methyl-
• 7,13a-Secoberbin-13a-one, 7-methyl-2,3:10,11-bis(methylenedioxy)-
• Pseudoprotopine

Pseudoprotopine

CAS: 24240-05-9

Pseudoprotopine is a useful organic compound for research related to life sciences. The catalog number is T125226 and the CAS number is 24240-05-9.

Formula: C₂₀H₁₉NO₅

Color and Shape: Solid

Molecular weight: 353.374

Ref: TM-T125226