CAS 24242-19-1
:5-Aminonicotinic acid
Description:
5-Aminonicotinic acid, with the CAS number 24242-19-1, is an organic compound that belongs to the class of aminonicotinic acids. It features a pyridine ring with an amino group and a carboxylic acid group, which contributes to its acidic properties. This compound is characterized by its ability to participate in various chemical reactions due to the presence of both the amino and carboxylic functional groups. It is typically a white to off-white crystalline solid, soluble in water and polar organic solvents, which enhances its utility in biochemical applications. 5-Aminonicotinic acid is of interest in medicinal chemistry and pharmacology, as it may exhibit biological activities, including potential roles in the synthesis of pharmaceuticals or as a biochemical probe. Its structural similarity to nicotinic acid suggests potential interactions with biological systems, particularly in relation to nicotinic receptors. Overall, 5-aminonicotinic acid is a versatile compound with applications in research and development within the fields of chemistry and biochemistry.
Formula:C6H5N2O2
InChI:InChI=1/C6H6N2O2/c7-5-1-4(6(9)10)2-8-3-5/h1-3H,7H2,(H,9,10)/p-1
SMILES:c1c(cncc1N)C(=O)[O-]
Synonyms:- 3-Amino-5-pyridinecarboxylic acid
- 5-Aminopyridine-3-Carboxylic Acid
- 5-Aminopyridine-3-Carboxylate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
5-Aminonicotinic Acid
CAS:Formula:C6H6N2O2Purity:>98.0%(T)(HPLC)Color and Shape:White - Yellow Solid FormMolecular weight:138.135-Aminonicotinic acid
CAS:5-Aminonicotinic acidFormula:C6H6N2O2Purity:≥95%Color and Shape: faint beige to brown powderMolecular weight:138.12g/mol5-Aminonicotinic acid
CAS:Formula:C6H6N2O2Purity:97%Color and Shape:Solid, Crystalline PowderMolecular weight:138.1265-Aminopyridine-3-carboxylic acid
CAS:5-Aminopyridine-3-carboxylic acid (5APC) is a structural analog of nicotinic acid that has been shown to have anti-inflammatory effects. 5APC inhibits the production of inflammatory cytokines, such as IL-10 and IL-17, by inhibiting the activation of NFκB and MAPK pathways. This drug also has significant inhibitory activities against dextran sulfate sodium (DSS)-induced acute colitis in experimental models. 5APC is thought to act by interrupting the assembly of p38 mitogen activated protein kinase (MAPK) and nuclear factor kappa B (NFκB) signaling complexes.
Formula:C6H6N2O2Purity:Min. 95%Molecular weight:138.12 g/mol





