CAS 24242-97-5

1-[4-(2-methylpropoxy)phenyl]ethanone

Description:

1-[4-(2-methylpropoxy)phenyl]ethanone, identified by its CAS number 24242-97-5, is an organic compound characterized by its ketone functional group and a phenyl ring substituted with a branched alkoxy group. This compound features a 2-methylpropoxy group attached to the para position of the phenyl ring, which influences its physical and chemical properties, such as solubility and reactivity. Typically, compounds of this nature exhibit moderate volatility and may have a distinct aromatic odor. The presence of the ketone group suggests potential reactivity in nucleophilic addition reactions, while the alkoxy substituent can enhance solubility in organic solvents. Additionally, the branched structure of the alkoxy group may affect the compound's steric hindrance and overall molecular interactions. As with many organic compounds, safety data should be consulted to understand its handling, storage, and potential hazards. Overall, 1-[4-(2-methylpropoxy)phenyl]ethanone is of interest in various chemical applications, including synthesis and material science.

Formula: C₁₂H₁₆O₂

InChI: InChI=1/C12H16O2/c1-9(2)8-14-12-6-4-11(5-7-12)10(3)13/h4-7,9H,8H2,1-3H3

SMILES: CC(C)COc1ccc(cc1)C(=O)C

Synonyms:

• Ethanone, 1-[4-(2-Methylpropoxy)Phenyl]-

1-(4-Isobutoxyphenyl)ethanone

CAS: 24242-97-5

Formula: C₁₂H₁₆O₂

Purity: 95%

Molecular weight: 192.2542

Ref: IN-DA00C1Z3

1-(4-Isobutoxyphenyl)ethan-1-one

CAS: 24242-97-5

1-(4-Isobutoxyphenyl)ethan-1-one

Purity: 95%

Molecular weight: 192.25g/mol

Ref: 54-OR75413

4′-iso-Butoxyacetophenone

CAS: 24242-97-5

Formula: C₁₂H₁₆O₂

Purity: 95%

Color and Shape: Liquid

Molecular weight: 192.258

Ref: 10-F307179