CAS 24242-99-7

1-[4-(3-methylbutoxy)phenyl]ethanone

Description:

1-[4-(3-methylbutoxy)phenyl]ethanone, with the CAS number 24242-99-7, is an organic compound characterized by its ketone functional group and aromatic structure. This substance features a phenyl ring substituted with a 3-methylbutoxy group, which contributes to its hydrophobic properties. The presence of the ethanone moiety indicates that it has a carbonyl group (C=O) adjacent to an ethyl group, which can influence its reactivity and interactions with other molecules. Typically, compounds like this may exhibit moderate volatility and solubility in organic solvents, while being less soluble in water due to their hydrophobic characteristics. The structure suggests potential applications in organic synthesis, possibly as an intermediate in the production of pharmaceuticals or agrochemicals. Additionally, the presence of the aromatic ring may impart stability and influence the compound's electronic properties, making it of interest in various chemical and industrial applications. Safety data should be consulted for handling and potential hazards associated with this compound.

Formula: C₁₃H₁₈O₂

InChI: InChI=1/C13H18O2/c1-10(2)8-9-15-13-6-4-12(5-7-13)11(3)14/h4-7,10H,8-9H2,1-3H3

SMILES: CC(C)CCOc1ccc(cc1)C(=O)C

Synonyms:

• 1-[4-(3-Methyl-butoxy)-phenyl]-ethanone
• Ethanone, 1-[4-(3-Methylbutoxy)Phenyl]-

1-(4-(Isopentyloxy)phenyl)ethanone

CAS: 24242-99-7

Formula: C₁₃H₁₈O₂

Molecular weight: 206.2808

Ref: IN-DA006WR0

1-[4-(3-Methyl-butoxy)-phenyl]-ethanone

CAS: 24242-99-7

Versatile small molecule scaffold

Formula: C₁₃H₁₈O₂

Purity: Min. 95%

Molecular weight: 206.28 g/mol

Ref: 3D-ZAA24299